| Chemical Information | |
| Antiviral agent ID | DrugRepV_3637 | |
| Antiviral agent name | N,N-bis(4-methylphenyl)pyridin-3-amine | |
| IUPAC Name | N,N-bis(4-methylphenyl)pyridin-3-amine |  |
| SMILES (canonical) | CC1=CC=C(C=C1)N(C1=CC=C(C)C=C1)C1=CN=CC=C1 | |
| Molecular Formula | C19H18N2 | |
| Molecular Weight (g/mol) | 274.367 | |
| InChl | InChI=1S/C19H18N2/c1-15-5-9-17(10-6-15)21(19-4-3-13-20-14-19)18-11-7-16(2)8-12-18/h3-14H,1-2H3 | |
| Structural Information | |
 |
|
| Clinical Information | |
| Biological Information | |
|
Secondary Indication | Ebola virus (EBOV) NA NA |   |
|
Secondary Indication (Approaches) | Experimental | |
| Secondary Indication (Methods) | In-vitro | |
|
Secondary Indication (Model system) [cell lines/ animal models] | 293T
| |
|
Secondary Indication (Mode of viral infection) | Transfection
| |
|
Secondary Indication (Mode of drug delivery) | Culture
| |
|
Secondary Indication (Time of drug delivery) | Post infection
| |
|
Secondary Indication (Duration of drug delivery) | 48 hours
| |
|
Secondary Indication (Drug concentration) | 23.5 μM
| |
|
Secondary Indication (Cell based assay) | Luciferase assay
| |
|
Secondary Indication (Change) | Decrease
| |
|
Secondary Indication (Type of Inhibition) | IC90 [ 90 % ] | |
|
Secondary Indication (Cytotoxicity) | >50 μM | |
|
Reference | Basu A, Li B, Mills DM, Panchal RG, Cardinale SC, Butler MM, Peet NP, Majgier-Baranowska H, Williams JD, Patel I, Moir DT, Bavari S, Ray R, Farzan MR, Rong L, Bowlin TL..Identification of a small-molecule entry inhibitor for filoviruses..J Virol. 2011 Apr;85(7):3106-19. doi: 10.1128/JVI.01456-10. Epub 2011 Jan 26. PubMed Central PMCID: PMID:21270170
|  |
|
Comment | A benzodiazepine derivative (compound 7) was identified from a high-throughput screen (HTS) of small-molecule compound libraries utilizing the pseudotype virus.
| |