| Chemical Information | |
| Antiviral agent ID | DrugRepV_3561 | |
| Antiviral agent name | Favipiravir |  |
| IUPAC Name | 5-fluoro-2-oxo-1H-pyrazine-3-carboxamide |  |
| SMILES (canonical) | C1=C(N=C(C(=O)N1)C(=O)N)F | |
| Molecular Formula | C5H4FN3O2 | |
| Molecular Weight (g/mol) | 157.1 | |
| InChl | InChI=1S/C5H4FN3O2/c6-2-1-8-5(11)3(9-2)4(7)10/h1H,(H2,7,10)(H,8,11) | |
| Common Name | Favipiravir | |
| Synonyms | T-705 | 6-fluoro-3-oxo-3,4-dihydropyrazine-2-carboxamide | 5-fluoro-2-oxo-1H-pyrazine-3-carboxamide | avigan | |
| Structural Information | |
 |
|
| Clinical Information | |
|
Category | Antiviral
| |
|
Primary Indication (Clinical trial phases) | Investigational
|  |
| Biological Information | |
|
Primary Indication (Disease Category) | Infectious Disease
| |
|
Primary Indication (Disease) | Influenza virus
| |
|
Secondary Indication | Chikungunya virus (CHIKV) NA 181/clone 25 |   |
|
Secondary Indication (Approaches) | Experimental | |
| Secondary Indication (Methods) | In-vitro | |
|
Secondary Indication (Model system) [cell lines/ animal models] | Huh-7
| |
|
Secondary Indication (Mode of viral infection) | Adsorption
| |
|
Secondary Indication (Viral titer) | 0.1 MOI
| |
|
Secondary Indication (Mode of drug delivery) | Culture
| |
|
Secondary Indication (Time of drug delivery) | Post infection
| |
|
Secondary Indication (Duration of drug delivery) | 3 days
| |
|
Secondary Indication (Drug concentration) | 20 μM
| |
|
Secondary Indication (Cell based assay) | Plaque assay
| |
|
Secondary Indication (Change) | Decrease
| |
|
Secondary Indication (Type of Inhibition) | EC50 [ 50 % ] | |
|
Secondary Indication (Cytotoxicity) | >1000 μM | |
|
Reference | Franco EJ, Rodriquez JL, Pomeroy JJ, Hanrahan KC, Brown AN.The effectiveness of antiviral agents with broad-spectrum activity against chikungunya virus varies.Antivir Chem Chemother. 2018 Jan-Dec;26:2040206618807580. doi: 10.1177 /2040206618807580 PMID:30354193
|  |
|
Comment | Favipiravir and interferon-alfa are the most promising candidates, as their use led to substantial reductions in viral burden at clinically achievable concentrations in two human-derived cell lines.
| |