| Chemical Information | |
| Antiviral agent ID | DrugRepV_3513 | |
| Antiviral agent name | Imidazopyridinamine IPA-1 | |
| IUPAC Name | N-{1-benzyl-1H-imidazo[4,5-c]pyridin-4-yl}-1H-indol-5-amine |  |
| SMILES (canonical) | C(N1C=NC2=C1C=CN=C2NC1=CC2=C(NC=C2)C=C1)C1=CC=CC=C1 | |
| Molecular Formula | C21H17N5 | |
| Molecular Weight (g/mol) | 339.402 | |
| InChl | InChI=1S/C21H17N5/c1-2-4-15(5-3-1)13-26-14-24-20-19(26)9-11-23-21(20)25-17-6-7-18-16(12-17)8-10-22-18/h1-12,14,22H,13H2,(H,23,25) | |
| Structural Information | |
 |
|
| Clinical Information | |
| Biological Information | |
|
Secondary Indication | Influenza virus (IAV) H1N1 A/Puerto Rico/8/1934 virus (NS1-GFP virus) |   |
|
Secondary Indication (Approaches) | Experimental | |
| Secondary Indication (Methods) | In-vitro | |
|
Secondary Indication (Model system) [cell lines/ animal models] | MDCK
| |
|
Secondary Indication (Mode of viral infection) | Adsorption
| |
|
Secondary Indication (Viral titer) | 0.05 MOI
| |
|
Secondary Indication (Mode of drug delivery) | Culture
| |
|
Secondary Indication (Drug concentration) | 2.8 μM
| |
|
Secondary Indication (Cell based assay) | PR8GFP Assay
| |
|
Secondary Indication (Change) | Decrease
| |
|
Secondary Indication (Type of Inhibition) | EC50 [ 50 % ] | |
|
Secondary Indication (Cytotoxicity) | >50 μM | |
|
Reference | Chang SY, Cruz DJ, Ko Y, Min JY..Identification of pyrrolo[3,2-c]pyridin-4-amine compounds as a new class of entry inhibitors against.Biochem Biophys Res Commun. 2016 Sep 30;478(4):1594-601. doi: 10.1016/j.bbrc.2016.08.162. Epub 2016 PMID:27586275
|  |
|
Comment | PPA showed broad-spectrum activity against multiple influenza A viruses and influenza B virus. PPA is an attractive chemical moiety that can be used to develop new antiviral drug candidates against influenza viruses.
| |