Chemical Information | |
Antiviral agent ID | DrugRepV_3491 | |
Antiviral agent name | Pyrrolopyridinamine PPA-1 | |
IUPAC Name | N-(4-methoxy-2-methylphenyl)-2-phenyl-1H-pyrrolo[3,2-c]pyridin-4-amine | |
SMILES (canonical) | COC1=CC=C(NC2=C3C=C(NC3=CC=N2)C2=CC=CC=C2)C(C)=C1 | |
Molecular Formula | C21H19N3O | |
Molecular Weight (g/mol) | 329.403 | |
InChl | InChI=1S/C21H19N3O/c1-14-12-16(25-2)8-9-18(14)24-21-17-13-20(15-6-4-3-5-7-15)23-19(17)10-11-22-21/h3-13,23H,1-2H3,(H,22,24) | |
Structural Information | |
|
|
Clinical Information | |
Biological Information | |
Secondary Indication | Influenza virus (IAV) H1N1 A/Puerto Rico/8/1934 virus (NS1-GFP virus) | |
Secondary Indication (Approaches) | Experimental | |
Secondary Indication (Methods) | In-vitro | |
Secondary Indication (Model system) [cell lines/ animal models] | A549
| |
Secondary Indication (Mode of viral infection) | Adsorption
| |
Secondary Indication (Viral titer) | 0.25 MOI
| |
Secondary Indication (Mode of drug delivery) | Culture
| |
Secondary Indication (Drug concentration) | 0.37 μM
| |
Secondary Indication (Cell based assay) | PR8GFP Assay
| |
Secondary Indication (Change) | Decrease
| |
Secondary Indication (Type of Inhibition) | EC50 [ 50 % ] | |
Secondary Indication (Cytotoxicity) | 41.17 μM | |
Reference | Chang SY, Cruz DJ, Ko Y, Min JY..Identification of pyrrolo[3,2-c]pyridin-4-amine compounds as a new class of entry inhibitors against.Biochem Biophys Res Commun. 2016 Sep 30;478(4):1594-601. doi: 10.1016/j.bbrc.2016.08.162. Epub 2016 PMID:27586275
| |
Comment | PPA showed broad-spectrum activity against multiple influenza A viruses and influenza B virus. PPA is an attractive chemical moiety that can be used to develop new antiviral drug candidates against influenza viruses.
| |