Chemical Information | |
Antiviral agent ID | DrugRepV_3420 | |
Antiviral agent name | Dapivirine | |
IUPAC Name | 4-[[4-(2,4,6-trimethylanilino)pyrimidin-2-yl]amino]benzonitrile | |
SMILES (canonical) | CC1=CC(=C(C(=C1)C)NC2=NC(=NC=C2)NC3=CC=C(C=C3)C#N)C | |
Molecular Formula | C20H19N5 | |
Molecular Weight (g/mol) | 329.407 | |
InChl | InChI=1S/C20H19N5/c1-13-10-14(2)19(15(3)11-13)24-18-8-9-22-20(25-18)23-17-6-4-16(12-21)5-7-17/h4-11H,1-3H3,(H2,22,23,24,25) | |
Common Name | Dapivirine | |
Synonyms | 4-((4-(mesitylamino)pyrimidin-2-yl)amino)benzonitrile | Dapivirinum | DapivirineTMC-120 | Ring-004 | 4-[[4-(2,4,6-trimethylanilino)pyrimidin-2-yl]amino]benzonitrile | |
Structural Information | |
|
|
Clinical Information | |
Primary Indication (Clinical trial phases) | Investigational
| |
Biological Information | |
Primary Indication (Disease Category) | Infectious Disease
| |
Primary Indication (Disease) | Acquired immunodeficiency syndrome
| |
Secondary Indication | Influenza virus (IAV) H1N1 A/WSN/1933 (H1N1) | |
Secondary Indication (Approaches) | Experimental | |
Secondary Indication (Methods) | In-vitro | |
Secondary Indication (Model system) [cell lines/ animal models] | A549
| |
Secondary Indication (Mode of viral infection) | Adsorption
| |
Secondary Indication (Viral titer) | 0.01 MOI
| |
Secondary Indication (Mode of drug delivery) | Culture
| |
Secondary Indication (Time of drug delivery) | Post infection
| |
Secondary Indication (Duration of drug delivery) | 24 hours
| |
Secondary Indication (Drug concentration) | 3 μM
| |
Secondary Indication (Cell based assay) | Plaque assay
| |
Secondary Indication (Change) | Decrease
| |
Secondary Indication (Type of Inhibition) | Log reduction [ 1.7 Log ] | |
Reference | Hu Y, Zhang J, Musharrafieh RG, Ma C, Hau R, Wang J..Discovery of dapivirine, a nonnucleoside HIV-1 reverse transcriptase inhibitor, as a broad-spectrum.Antiviral Res. 2017 Sep;145:103-113. doi: 10.1016/j.antiviral.2017.07.016. Epub 2017 Aug 2. PMID:28778830
| |
Comment | Dapivirine inhibits the nuclear entry of viral ribonucleoproteins at the early stage of viral replication. As a result, viral RNA and protein synthesis were inhibited
| |