Chemical Information | |
Antiviral agent ID | DrugRepV_3377 | |
Antiviral agent name | Ribavirin | |
IUPAC Name | 1-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-1,2,4-triazole-3-carboxamide | |
SMILES (canonical) | C1=NC(=NN1C2C(C(C(O2)CO)O)O)C(=O)N | |
SMILES (isomeric) | C1=NC(=NN1[C@H]2[C@@H]([C@@H]([C@H](O2)CO)O)O)C(=O)N | |
Molecular Formula | C8H12N4O5 | |
Molecular Weight (g/mol) | 244.207 | |
InChl | InChI=1S/C8H12N4O5/c9-6(16)7-10-2-12(11-7)8-5(15)4(14)3(1-13)17-8/h2-5,8,13-15H,1H2,(H2,9,16)/t3-,4-,5-,8-/m1/s1 | |
Common Name | Ribavirin | |
Synonyms | 1-beta-D-Ribofuranosyl-1,2,4-triazole-3-carboxamide | 1-beta-D-Ribofuranosyl-1H-1,2,4-triazole-3-carboxamide | RBV | Ribavirin | Ribavirina | Ribavirine | Ribavirinum | Tribavirin | |
Structural Information | |
|
|
Clinical Information | |
Category | Antiinfectives For Systemic Use
| |
Primary Indication (Clinical trial phases) | Approved
| |
Biological Information | |
Primary Indication (Disease Category) | Infectious Disease
| |
Primary Indication (Disease) | Hepatitis C virus
| |
Primary Indication (Drug target/Mode of Action) | Potential E3 ubiquitin-protein ligase ariadne-2
| |
Secondary Indication | Middle East respiratory syndrome coronavirus (MERS-CoV) NA NA | |
Secondary Indication (Approaches) | Experimental | |
Secondary Indication (Methods) | In-vitro | |
Secondary Indication (Model system) [cell lines/ animal models] | Vero
| |
Secondary Indication (Mode of viral infection) | Adsorption
| |
Secondary Indication (Viral titer) | 0.0001 MOI
| |
Secondary Indication (Mode of drug delivery) | Culture
| |
Secondary Indication (Time of drug delivery) | Post infection
| |
Secondary Indication (Duration of drug delivery) | 3 days
| |
Secondary Indication (Drug concentration) | 9.99 ± 2.97 μM
| |
Secondary Indication (Cell based assay) | CPE inhibition assay
| |
Secondary Indication (Change) | Decrease
| |
Secondary Indication (Type of Inhibition) | EC50 [ 50 % ] | |
Secondary Indication (Cytotoxicity) | >1600 μM | |
Reference | Chan JF, Chan KH, Kao RY, To KK, Zheng BJ, Li CP, Li PT, Dai J, Mok FK, Chen H, Hayden FG, Yuen KY..Broad-spectrum antivirals for the emerging Middle East respiratory syndrome coronavirus..J Infect. 2013 Dec;67(6):606-16. doi: 10.1016/j.jinf.2013.09.029. Epub 2013 Oct 3. PMID:24096239
| |
Comment | Mycophenolic acid exhibited low EC50 and high selectivity index. Additionally, ribavirin and interferons also exhibited in-vitro anti-MERS-CoV activity
| |