| Chemical Information | |
| Antiviral agent ID | DrugRepV_3375 | |
| Antiviral agent name | Mycophenolic Acid |  |
| IUPAC Name | (E)-6-(4-hydroxy-6-methoxy-7-methyl-3-oxo-1H-2-benzofuran-5-yl)-4-methylhex-4-enoic acid |  |
| SMILES (canonical) | CC1=C(C(=C(C2=C1COC2=O)O)CC=C(C)CCC(=O)O)OC | |
| SMILES (isomeric) | CC1=C(C(=C(C2=C1COC2=O)O)C/C=C(\C)/CCC(=O)O)OC | |
| Molecular Formula | C17H20O6 | |
| Molecular Weight (g/mol) | 320.341 | |
| InChl | InChI=1S/C17H20O6/c1-9(5-7-13(18)19)4-6-11-15(20)14-12(8-23-17(14)21)10(2)16(11)22-3/h4,20H,5-8H2,1-3H3,(H,18,19)/b9-4+ | |
| Common Name | Mycophenolic acid | |
| Synonyms | (e)-6-(4-Hydroxy-6-methoxy-7-methyl-3-oxo-5-phthalanyl)-4-methyl-4-hexenoic acid | Acide mycophenolique | Acido micofenolico | Acidum mycophenolicum | Micofenolico acido | Mycophenolate | Mycophenolsäure | |
| Structural Information | |
 |
|
| Clinical Information | |
|
Category | Antineoplastic and Immunomodulating Agents
| |
|
Primary Indication (Clinical trial phases) | Approved
|  |
| Biological Information | |
|
Primary Indication (Disease Category) | Non Infectious Disease
| |
|
Primary Indication (Disease) | Organ rejection (immunosuppressants)
| |
|
Secondary Indication | Middle East respiratory syndrome coronavirus (MERS-CoV) NA NA |   |
|
Secondary Indication (Approaches) | Experimental | |
| Secondary Indication (Methods) | In-vitro | |
|
Secondary Indication (Model system) [cell lines/ animal models] | Vero
| |
|
Secondary Indication (Mode of viral infection) | Adsorption
| |
|
Secondary Indication (Viral titer) | 0.0001 MOI
| |
|
Secondary Indication (Mode of drug delivery) | Culture
| |
|
Secondary Indication (Time of drug delivery) | Post infection
| |
|
Secondary Indication (Duration of drug delivery) | 3 days
| |
|
Secondary Indication (Drug concentration) | 0.17 ± 0.03 μM
| |
|
Secondary Indication (Cell based assay) | CPE inhibition assay
| |
|
Secondary Indication (Change) | Decrease
| |
|
Secondary Indication (Type of Inhibition) | EC50 [ 50 % ] | |
|
Secondary Indication (Cytotoxicity) | >32 μM | |
|
Reference | Chan JF, Chan KH, Kao RY, To KK, Zheng BJ, Li CP, Li PT, Dai J, Mok FK, Chen H, Hayden FG, Yuen KY..Broad-spectrum antivirals for the emerging Middle East respiratory syndrome coronavirus..J Infect. 2013 Dec;67(6):606-16. doi: 10.1016/j.jinf.2013.09.029. Epub 2013 Oct 3. PMID:24096239
|  |
|
Comment | Mycophenolic acid exhibited low EC50 and high selectivity index. Additionally, ribavirin and interferons also exhibited in-vitro anti-MERS-CoV activity
| |