| Chemical Information | |
| Antiviral agent ID | DrugRepV_3357 | |
| Antiviral agent name | Naproxen |  |
| IUPAC Name | (2S)-2-(6-methoxynaphthalen-2-yl)propanoic acid |  |
| SMILES (canonical) | CC(C1=CC2=C(C=C1)C=C(C=C2)OC)C(=O)O | |
| SMILES (isomeric) | C[C@@H](C1=CC2=C(C=C1)C=C(C=C2)OC)C(=O)O | |
| Molecular Formula | C14H14O3 | |
| Molecular Weight (g/mol) | 230.263 | |
| InChl | InChI=1S/C14H14O3/c1-9(14(15)16)10-3-4-12-8-13(17-2)6-5-11(12)7-10/h3-9H,1-2H3,(H,15,16)/t9-/m0/s1 | |
| Common Name | Naproxen | |
| Synonyms | (+)-(S)-6-Methoxy-α-methyl-2-naphthaleneacetic acid | (+)-(S)-Naproxen | (+)-2-(6-Methoxy-2-naphthyl)propionic acid | (+)-2-(Methoxy-2-naphthyl)-propionic acid | (+)-2-(Methoxy-2-naphthyl)-propionsäure | (+)-Naproxen | (S)-(+)-2-(6-Methoxy-2-naphthyl)propionic acid | (S)-(+)-Naproxen | (S)-2-(6-Methoxy-2-naphthyl)propanoic acid | (S)-2-(6-Methoxy-2-naphthyl)propionic acid | (S)-6-Methoxy-alpha-methyl-2-naphthaleneacetic acid | (S)-Naproxen | Naprolag | Naproxen | Naproxène | Naproxeno | Napro | |
| Structural Information | |
 |
|
| Clinical Information | |
|
Category | Musculo-Skeletal System
| |
|
Primary Indication (Clinical trial phases) | Approved
|  |
| Biological Information | |
|
Primary Indication (Disease Category) | Non Infectious Disease
| |
|
Primary Indication (Disease) | Rheumatoid arthritis | Osteoarthritis | Ankylosing spondylitis | Polyarticular juvenile idiopathic arthritis | Tendinitis | Bursitis | Acute gout | Primary dysmenorrhea
| |
|
Secondary Indication | Influenza virus (IAV) H3N2 A/Udorn/72 |   |
|
Secondary Indication (Approaches) | Experimental | |
| Secondary Indication (Methods) | In-vitro | |
|
Secondary Indication (Model system) [cell lines/ animal models] | A549
| |
|
Secondary Indication (Mode of viral infection) | Adsorption
| |
|
Secondary Indication (Viral titer) | 2 MOI
| |
|
Secondary Indication (Mode of drug delivery) | Culture
| |
|
Secondary Indication (Time of drug delivery) | Post infection
| |
|
Secondary Indication (Duration of drug delivery) | 18 hours
| |
|
Secondary Indication (Drug concentration) | 112 ± 21 μM
| |
|
Secondary Indication (Cell based assay) | Plaque assay
| |
|
Secondary Indication (Change) | Decrease
| |
|
Secondary Indication (Type of Inhibition) | IC50 [ 50 % ] | |
|
Secondary Indication (Cytotoxicity) | 1.4 ± 0.5 mM | |
|
Reference | Dilly S, Fotso Fotso A, Lejal N, Zedda G, Chebbo M, Rahman F, Companys S, Bertrand HC, Vidic J, Noir.From Naproxen Repurposing to Naproxen Analogues and Their Antiviral Activity against Influenza A Vir.J Med Chem. 2018 Aug 23;61(16):7202-7217. doi: 10.1021/acs.jmedchem.8b00557. Epub 2018 Aug 3. PMID:30028133
|  |
|
Comment | The new naproxen analogues present a relatively low molecular weight, a good solubility in aqueous solution, properties of many drug-like compounds.
| |