Chemical Information | |
Antiviral agent ID | DrugRepV_3288 | |
Antiviral agent name | Pazopanib | |
IUPAC Name | 5-[[4-[(2,3-dimethylindazol-6-yl)-methylamino]pyrimidin-2-yl]amino]-2-methylbenzenesulfonamide | |
SMILES (canonical) | CC1=C(C=C(C=C1)NC2=NC=CC(=N2)N(C)C3=CC4=NN(C(=C4C=C3)C)C)S(=O)(=O)N | |
Molecular Formula | C21H23N7O2S | |
Molecular Weight (g/mol) | 437.522 | |
InChl | InChI=1S/C21H23N7O2S/c1-13-5-6-15(11-19(13)31(22,29)30)24-21-23-10-9-20(25-21)27(3)16-7-8-17-14(2)28(4)26-18(17)12-16/h5-12H,1-4H3,(H2,22,29,30)(H,23,24,25) | |
Common Name | Pazopanib | |
Synonyms | GW 78603 | Pazopanibum | |
Structural Information | |
|
|
Clinical Information | |
Category | Antineoplastic and Immunomodulating Agents
| |
Primary Indication (Clinical trial phases) | Approved
| |
Biological Information | |
Primary Indication (Disease Category) | Non Infectious Disease
| |
Primary Indication (Disease) | Advanced renal cell cancer | Advanced soft tissue sarcoma
| |
Secondary Indication | Chikungunya virus (CHIKV) NA NA | |
Secondary Indication (Approaches) | Experimental | |
Secondary Indication (Methods) | In-vitro | |
Secondary Indication (Potential drug target) | Fms-related tyrosine kinase 4
| |
Secondary Indication (Model system) [cell lines/ animal models] | HEK-293
| |
Secondary Indication (Mode of viral infection) | Adsorption
| |
Secondary Indication (Mode of drug delivery) | Culture
| |
Secondary Indication (Time of drug delivery) | Pre infection (1 hour)
| |
Secondary Indication (Drug concentration) | 0.13 μM
| |
Secondary Indication (Cell based assay) | Flow cytometry
| |
Secondary Indication (Change) | Decrease
| |
Secondary Indication (Type of Inhibition) | IC50 [ 50 % ] | |
Reference | Karlas A, Berre S, Couderc T, Varjak M, Braun P, Meyer M, Gangneux N, Karo-Astover L, Weege F, Rafte.A human genome-wide loss-of-function screen identifies effective chikungunya antiviral drugs..Nat Commun. 2016 May 12;7:11320. doi: 10.1038/ncomms11320. PMID:27177310
| |
Comment | Calmodulin inhibitor pimozide and the fatty acid synthesis inhibitor TOFA, have a therapeutic effect in vivo
| |