| Chemical Information | |
| Antiviral agent ID | DrugRepV_3166 | |
| Antiviral agent name | Glycyrrhizin |  |
| IUPAC Name | (2S,3S,4S,5R,6R)-6-[(2S,3R,4S,5S,6S)-2-[[(3S,4aR,6aR,6bS,8aS,11S,12aR,14aR,14bS)-11-carboxy-4,4,6a,6b,8a,11,14b-heptamethyl-14-oxo-2,3,4a,5,6,7,8,9,10,12,12a,14a-dodecahydro-1H-picen-3-yl]oxy]-6-carboxy-4,5-dihydroxyoxan-3-yl]oxy-3,4,5-trihydroxyoxane-2-carboxylic acid |  |
| SMILES (canonical) | CC1(C2CCC3(C(C2(CCC1OC4C(C(C(C(O4)C(=O)O)O)O)OC5C(C(C(C(O5)C(=O)O)O)O)O)C)C(=O)C=C6C3(CCC7(C6CC(CC7)(C)C(=O)O)C)C)C)C | |
| SMILES (isomeric) | C[C@]12CC[C@](C[C@H]1C3=CC(=O)[C@@H]4[C@]5(CC[C@@H](C([C@@H]5CC[C@]4([C@@]3(CC2)C)C)(C)C)O[C@@H]6[C@@H]([C@H]([C@@H]([C@H](O6)C(=O)O)O)O)O[C@H]7[C@@H]([C@H]([C@@H]([C@H](O7)C(=O)O)O)O)O)C)(C)C(=O)O | |
| Molecular Formula | C42H62O16 | |
| Molecular Weight (g/mol) | 822.942 | |
| InChl | InChI=1S/C42H62O16/c1-37(2)21-8-11-42(7)31(20(43)16-18-19-17-39(4,36(53)54)13-12-38(19,3)14-15-41(18,42)6)40(21,5)10-9-22(37)55-35-30(26(47)25(46)29(57-35)33(51)52)58-34-27(48)23(44)24(45)28(56-34)32(49)50/h16,19,21-31,34-35,44-48H,8-15,17H2,1-7H3,(H,49,50)(H,51,52)(H,53,54)/t19-,21-,22-,23-,24-,25-,26-,27+,28-,29-,30+,31+,34-,35-,38+,39-,40-,41+,42+/m0/s1 | |
| Common Name | Glycyrrhizic acid | |
| Synonyms | 18-beta-Glycyrrhizic acid | Glizigen | Glycyrrhizin | |
| Structural Information | |
 |
|
| Clinical Information | |
|
Category | Alimentary Tract and Metabolism
| |
|
Primary Indication (Clinical trial phases) | Approved, Experimental
|  |
| Biological Information | |
|
Primary Indication (Disease Category) | Infectious Disease
| |
|
Primary Indication (Disease) | Chronic hepatitis
| |
|
Secondary Indication | Chikungunya virus (CHIKV) NA Ross C347 |   |
|
Secondary Indication (Approaches) | Experimental | |
| Secondary Indication (Methods) | In-vitro | |
|
Secondary Indication (Model system) [cell lines/ animal models] | Vero
| |
|
Secondary Indication (Mode of viral infection) | Adsorption
| |
|
Secondary Indication (Viral titer) | 0.001 MOI
| |
|
Secondary Indication (Mode of drug delivery) | Culture
| |
|
Secondary Indication (Drug concentration) | 2500 μg/ml
| |
|
Secondary Indication (Cell based assay) | Cytopathic effect (CPE) assay
| |
|
Secondary Indication (Change) | Decrease
| |
|
Secondary Indication (Type of Inhibition) | Virus titer [ 5.2 Log ] | |
|
Reference | Briolant S, Garin D, Scaramozzino N, Jouan A, Crance JM..In vitro inhibition of Chikungunya and Semliki Forest viruses replication by antiviral compounds: sy.Antiviral Res. 2004 Feb;61(2):111-7. PMID:14670584
|  |
|
Comment | Ribavirin, 6-azauridine was more effective against CHIKV and showed a similar antiviral activity against SFV. IFN-????2b, glycyrrhizin, 6-azauridine, and ribavirin caused a concentration-dependent reduction in the virus yield with CHIKV and SFV
| |