| Chemical Information | |
| Antiviral agent ID | DrugRepV_3116 | |
| Antiviral agent name | Daunorubicin Hydrochloride |  |
| IUPAC Name | (7S,9S)-9-acetyl-7-[(2R,4S,5S,6S)-4-amino-5-hydroxy-6-methyloxan-2-yl]oxy-6,9,11-trihydroxy-4-methoxy-8,10-dihydro-7H-tetracene-5,12-dione;hydrochloride |  |
| SMILES (canonical) | CC1C(C(CC(O1)OC2CC(CC3=C(C4=C(C(=C23)O)C(=O)C5=C(C4=O)C=CC=C5OC)O)(C(=O)C)O)N)O.Cl | |
| SMILES (isomeric) | C[C@H]1[C@H]([C@H](C[C@@H](O1)O[C@H]2C[C@@](CC3=C(C4=C(C(=C23)O)C(=O)C5=C(C4=O)C=CC=C5OC)O)(C(=O)C)O)N)O.Cl | |
| Molecular Formula | C27H30ClNO10 | |
| Molecular Weight (g/mol) | 563.984 | |
| InChl | InChI=1S/C27H29NO10.ClH/c1-10-22(30)14(28)7-17(37-10)38-16-9-27(35,11(2)29)8-13-19(16)26(34)21-20(24(13)32)23(31)12-5-4-6-15(36-3)18(12)25(21)33;/h4-6,10,14,16-17,22,30,32,34-35H,7-9,28H2,1-3H3;1H/t10-,14-,16-,17-,22+,27-;/m0./s1 | |
| Common Name | Daunorubicin hydrochloride | |
| Synonyms | DAUNORUBICIN HCL | DAUNORUBICIN HYDROCHLORIDE | Daunomycin hydrochloride | Daunoblastina | Daunomycin HCL | Rubidomycin hydrochloride | daunorubicinol hydrochloride | |
| Structural Information | |
 |
|
| Clinical Information | |
|
Category | Antineoplastic and Immunomodulating Agents
| |
|
Primary Indication (Clinical trial phases) | Approved
|  |
| Biological Information | |
|
Primary Indication (Disease Category) | Non Infectious Disease
| |
|
Primary Indication (Disease) | Leukemia
| |
|
Secondary Indication | Chikungunya virus (CHIKV) NA CHIKV-0708 |   |
|
Secondary Indication (Approaches) | Experimental | |
| Secondary Indication (Methods) | In-vitro | |
|
Secondary Indication (Model system) [cell lines/ animal models] | BHK-21
| |
|
Secondary Indication (Mode of viral infection) | Adsorption
| |
|
Secondary Indication (Viral titer) | 1 MOI
| |
|
Secondary Indication (Mode of drug delivery) | Culture
| |
|
Secondary Indication (Time of drug delivery) | Post infection
| |
|
Secondary Indication (Duration of drug delivery) | 24 hours
| |
|
Secondary Indication (Drug concentration) | 10 μM
| |
|
Secondary Indication (Cell based assay) | Immunoflourescence assay
| |
|
Secondary Indication (Change) | Decrease
| |
|
Secondary Indication (Type of Inhibition) | Percentage inhibition [ 95.56 % ] | |
|
Reference | Kaur P, Thiruchelvan M, Lee RC, Chen H, Chen KC, Ng ML, Chu JJ..Inhibition of chikungunya virus replication by harringtonine, a novel antiviral that suppresses vira.Antimicrob Agents Chemother. 2013 Jan;57(1):155-67. doi: 10.1128/AAC.01467-12. Epub 2012 Oct 22. PMID:23275491
|  |
|
Comment | Harringtonine inhibited an early stage of chikungunya virus replication which occurred after viral entry into cell. Its affects CHIKV RNA production as well as viral protein expression. Harringtonine also inhibited Sindbis virus replication.
| |