| Chemical Information | |
| Antiviral agent ID | DrugRepV_3115 | |
| Antiviral agent name | Magnolol | |
| IUPAC Name | 2-(2-hydroxy-5-prop-2-enylphenyl)-4-prop-2-enylphenol |  |
| SMILES (canonical) | C=CCC1=CC(=C(C=C1)O)C2=C(C=CC(=C2)CC=C)O | |
| Molecular Formula | C18H18O2 | |
| Molecular Weight (g/mol) | 266.34 | |
| InChl | InChI=1S/C18H18O2/c1-3-5-13-7-9-17(19)15(11-13)16-12-14(6-4-2)8-10-18(16)20/h3-4,7-12,19-20H,1-2,5-6H2 | |
| Structural Information | |
 |
|
| Clinical Information | |
| Biological Information | |
|
Secondary Indication | Chikungunya virus (CHIKV) NA CHIKV-0708 |   |
|
Secondary Indication (Approaches) | Experimental | |
| Secondary Indication (Methods) | In-vitro | |
|
Secondary Indication (Model system) [cell lines/ animal models] | BHK-21
| |
|
Secondary Indication (Mode of viral infection) | Adsorption
| |
|
Secondary Indication (Viral titer) | 1 MOI
| |
|
Secondary Indication (Mode of drug delivery) | Culture
| |
|
Secondary Indication (Time of drug delivery) | Post infection
| |
|
Secondary Indication (Duration of drug delivery) | 24 hours
| |
|
Secondary Indication (Drug concentration) | 10 μM
| |
|
Secondary Indication (Cell based assay) | Immunoflourescence assay
| |
|
Secondary Indication (Change) | Decrease
| |
|
Secondary Indication (Type of Inhibition) | Percentage inhibition [ 95.74 % ] | |
|
Reference | Kaur P, Thiruchelvan M, Lee RC, Chen H, Chen KC, Ng ML, Chu JJ..Inhibition of chikungunya virus replication by harringtonine, a novel antiviral that suppresses vira.Antimicrob Agents Chemother. 2013 Jan;57(1):155-67. doi: 10.1128/AAC.01467-12. Epub 2012 Oct 22. PMID:23275491
|  |
|
Comment | Harringtonine inhibited an early stage of chikungunya virus replication which occurred after viral entry into cell. Its affects CHIKV RNA production as well as viral protein expression. Harringtonine also inhibited Sindbis virus replication.
| |