| Chemical Information | |
| Antiviral agent ID | DrugRepV_3065 | |
| Antiviral agent name | Cerivastatin |  |
| IUPAC Name | (E,3R,5S)-7-[4-(4-fluorophenyl)-5-(methoxymethyl)-2,6-di(propan-2-yl)pyridin-3-yl]-3,5-dihydroxyhept-6-enoic acid |  |
| SMILES (canonical) | CC(C)C1=C(C(=C(C(=N1)C(C)C)C=CC(CC(CC(=O)O)O)O)C2=CC=C(C=C2)F)COC | |
| SMILES (isomeric) | CC(C)C1=C(C(=C(C(=N1)C(C)C)/C=C/[C@H](C[C@H](CC(=O)O)O)O)C2=CC=C(C=C2)F)COC | |
| Molecular Formula | C26H34FNO5 | |
| Molecular Weight (g/mol) | 459.558 | |
| InChl | InChI=1S/C26H34FNO5/c1-15(2)25-21(11-10-19(29)12-20(30)13-23(31)32)24(17-6-8-18(27)9-7-17)22(14-33-5)26(28-25)16(3)4/h6-11,15-16,19-20,29-30H,12-14H2,1-5H3,(H,31,32)/b11-10+/t19-,20-/m1/s1 | |
| Common Name | Cerivastatin | |
| Synonyms | Baycol | Cerivastatin acid | Lipobay | HSDB 7357 | |
| Structural Information | |
 |
|
| Clinical Information | |
|
Category | Cardiovascular agents
| |
|
Primary Indication (Clinical trial phases) | Approved
|  |
| Biological Information | |
|
Primary Indication (Disease Category) | Non Infectious Disease
| |
|
Primary Indication (Disease) | Rhabdomyolysis
| |
|
Secondary Indication | Chikungunya virus (CHIKV) NA CHIKV-Rluc |   |
|
Secondary Indication (Approaches) | Experimental | |
| Secondary Indication (Methods) | In-vitro | |
|
Secondary Indication (Model system) [cell lines/ animal models] | BHK-21
| |
|
Secondary Indication (Mode of viral infection) | Transfection
| |
|
Secondary Indication (Viral titer) | 0.01 MOI
| |
|
Secondary Indication (Mode of drug delivery) | Culture
| |
|
Secondary Indication (Drug concentration) | 10 μM
| |
|
Secondary Indication (Cell based assay) | Renilla luciferase assay
| |
|
Secondary Indication (Change) | No significant effect
| |
|
Secondary Indication (Type of Inhibition) | Percentage inhibition [ 10 % ] | |
|
Reference | Varghese FS, Kaukinen P, GlÌÄå_sker S, Bespalov M, Hanski L, Wennerberg K, KÌÄå_mmerer BM, Ahola T..Discovery of berberine, abamectin and ivermectin as antivirals against chikungunya and other alphavi.Antiviral Res. 2016 Feb;126:117-24. doi: 10.1016/j.antiviral.2015.12.012. Epub 2016 Jan 2. PMID:26752081
|  |
|
Comment | Abamectin and ivermectin are fermentation products generated by a soil dwelling actinomycete, Streptomyces avermitilis, whereas berberine is a plant-derived isoquinoline alkaloid.These drugs inhibits Chikungunya virus, Semliki forest virus and Sindbis virus replication in dose-dependent manner. Abamectin and ivermectin were also active against yellow fever virus.
| |