| Chemical Information | |
| Antiviral agent ID | DrugRepV_3017 | |
| Antiviral agent name | Curcumin |  |
| IUPAC Name | (1E,6E)-1,7-bis(4-hydroxy-3-methoxyphenyl)hepta-1,6-diene-3,5-dione |  |
| SMILES (canonical) | COC1=C(C=CC(=C1)C=CC(=O)CC(=O)C=CC2=CC(=C(C=C2)O)OC)O | |
| SMILES (isomeric) | COC1=C(C=CC(=C1)/C=C/C(=O)CC(=O)/C=C/C2=CC(=C(C=C2)O)OC)O | |
| Molecular Formula | C21H20O6 | |
| Molecular Weight (g/mol) | 368.385 | |
| InChl | InChI=1S/C21H20O6/c1-26-20-11-14(5-9-18(20)24)3-7-16(22)13-17(23)8-4-15-6-10-19(25)21(12-15)27-2/h3-12,24-25H,13H2,1-2H3/b7-3+,8-4+ | |
| Common Name | Curcumin | |
| Synonyms | Diferuloylmethane | Natural yellow 3 | Turmeric yellow | Curcuma | Turmeric | Indian saffron | Kacha haldi | Gelbwurz | |
| Structural Information | |
 |
|
| Clinical Information | |
|
Primary Indication (Clinical trial phases) | Approved
|  |
| Biological Information | |
|
Primary Indication (Disease Category) | Non Infectious Disease
| |
|
Primary Indication (Disease) | Cancer, mucositis, chronic schizophrenia and mild cognitive impairment
| |
|
Secondary Indication | Chikungunya virus (CHIKV) NA La Reunion strain, 06-049 AM258994 |   |
|
Secondary Indication (Approaches) | Experimental | |
| Secondary Indication (Methods) | In-vitro | |
|
Secondary Indication (Model system) [cell lines/ animal models] | Hela
| |
|
Secondary Indication (Mode of viral infection) | Adsorption
| |
|
Secondary Indication (Viral titer) | 1 MOI
| |
|
Secondary Indication (Mode of drug delivery) | Culture
| |
|
Secondary Indication (Time of drug delivery) | Pre infection (4 hours)
| |
|
Secondary Indication (Duration of drug delivery) | 24 hours
| |
|
Secondary Indication (Drug concentration) | 5 μM
| |
|
Secondary Indication (Cell based assay) | Real-time PCR
| |
|
Secondary Indication (Change) | Decrease
| |
|
Secondary Indication (Type of Inhibition) | log reduction [ 0.7 log ] | |
|
Reference | Mounce BC, Cesaro T, Carrau L, Vallet T, Vignuzzi M..Curcumin inhibits Zika and chikungunya virus infection by inhibiting cell binding..Antiviral Res. 2017 Jun;142:148-157. doi: 10.1016/j.antiviral.2017.03.014. Epub 2017 Mar 24. PMID:28343845
|  |
|
Comment | Curcumin interfered with the binding of the enveloped viruses to cells in a dose-dependent manner, though the integrity of the viral RNA was maintained. Together, these results expand the family of viruses sensitive to curcumin and provide a mechanism of action for curcumin's effect on these enveloped viruses.
| |