Chemical Information | |
Antiviral agent ID | DrugRepV_2996 | |
Antiviral agent name | Flavaglines FL3 | |
IUPAC Name | (1R,3S,3aR,8bS)-3a-(4-Bromophenyl)-6,8-dimethoxy-3-phenyl-1,2,3,3a-tetrahydro-8bH-benzo[b]cyclopenta[d]furan-1,8b-diol | |
SMILES (isomeric) | COc1cc2c(c(c1)OC)[C@@]3([C@@H](C[C@H]([C@@]3(O2)c4ccc(cc4)Br)c5ccccc5)O)O | |
Molecular Formula | C25H23BrO5 | |
Molecular Weight (g/mol) | 483.351 | |
InChl | InChI=1S/C25H23BrO5/c1-29-18-12-20(30-2)23-21(13-18)31-25(16-8-10-17(26)11-9-16)19(14-22(27)24(23,25)28)15-6-4-3-5-7-15/h3-13,19,22,27-28H,14H2,1-2H3/t19-,22+,24+,25-/m0/s1 | |
Structural Information | |
|
|
Clinical Information | |
Category | Anticancer
| |
Biological Information | |
Secondary Indication | Chikungunya virus (CHIKV) NA NA | |
Secondary Indication (Approaches) | Experimental | |
Secondary Indication (Methods) | In-vitro | |
Secondary Indication (Model system) [cell lines/ animal models] | HEK-293T/17
| |
Secondary Indication (Mode of viral infection) | Adsorption
| |
Secondary Indication (Viral titer) | 10 PFU/cell
| |
Secondary Indication (Mode of drug delivery) | Culture
| |
Secondary Indication (Time of drug delivery) | Pre infection (1 hour)
| |
Secondary Indication (Duration of drug delivery) | 20 hours
| |
Secondary Indication (Drug concentration) | 20 nM
| |
Secondary Indication (Cell based assay) | Plaque assay
| |
Secondary Indication (Change) | Decrease
| |
Secondary Indication (Type of Inhibition) | Percentage inhibition [ 50 % ] | |
Reference | Wintachai P, Thuaud F, Basmadjian C, Roytrakul S, Ubol S, DÌÄå©saubry L, Smith DR..Assessment of flavaglines as potential chikungunya virus entry inhibitors..Microbiol Immunol. 2015 Mar;59(3):129-41. doi: 10.1111/1348-0421.12230. PMID:25643977
| |
Comment | Synthetic sulfonyl amidines and flavaglines (FLs), a class of naturally occurring plant compounds with potent anti-cancer and cytoprotective and neuroprotective activities, have been shown to interact directly with prohibitin.
| |