| Chemical Information | |
| Antiviral agent ID | DrugRepV_2983 | |
| Antiviral agent name | Mycophenolic Acid |  |
| IUPAC Name | (E)-6-(4-hydroxy-6-methoxy-7-methyl-3-oxo-1H-2-benzofuran-5-yl)-4-methylhex-4-enoic acid |  |
| SMILES (canonical) | CC1=C(C(=C(C2=C1COC2=O)O)CC=C(C)CCC(=O)O)OC | |
| SMILES (isomeric) | CC1=C(C(=C(C2=C1COC2=O)O)C/C=C(\C)/CCC(=O)O)OC | |
| Molecular Formula | C17H20O6 | |
| Molecular Weight (g/mol) | 320.341 | |
| InChl | InChI=1S/C17H20O6/c1-9(5-7-13(18)19)4-6-11-15(20)14-12(8-23-17(14)21)10(2)16(11)22-3/h4,20H,5-8H2,1-3H3,(H,18,19)/b9-4+ | |
| Common Name | Mycophenolic acid | |
| Synonyms | (e)-6-(4-Hydroxy-6-methoxy-7-methyl-3-oxo-5-phthalanyl)-4-methyl-4-hexenoic acid | Acide mycophenolique | Acido micofenolico | Acidum mycophenolicum | Micofenolico acido | Mycophenolate | Mycophenolsäure | |
| Structural Information | |
 |
|
| Clinical Information | |
|
Category | Antineoplastic and Immunomodulating Agents
| |
|
Primary Indication (Clinical trial phases) | Approved
|  |
| Biological Information | |
|
Primary Indication (Disease Category) | Non Infectious Disease
| |
|
Primary Indication (Disease) | Organ rejection (immunosuppressants)
| |
|
Secondary Indication | Chikungunya virus (CHIKV) NA CHIKV replicon |   |
|
Secondary Indication (Approaches) | Experimental | |
| Secondary Indication (Methods) | In-vitro | |
|
Secondary Indication (Model system) [cell lines/ animal models] | BHK-CHIKV-NCT
| |
|
Secondary Indication (Mode of viral infection) | Adsorption
| |
|
Secondary Indication (Viral titer) | 0.001 MOI
| |
|
Secondary Indication (Mode of drug delivery) | Culture
| |
|
Secondary Indication (Time of drug delivery) | Post infection (16 hours)
| |
|
Secondary Indication (Duration of drug delivery) | 48 hours
| |
|
Secondary Indication (Drug concentration) | 1.5 μM
| |
|
Secondary Indication (Cell based assay) | EGFP assay
| |
|
Secondary Indication (Change) | Decrease
| |
|
Secondary Indication (Type of Inhibition) | IC50 [ 50 % ] | |
|
Secondary Indication (Cytotoxicity) | >200 μM | |
|
Reference | Pohjala L, Utt A, Varjak M, Lulla A, Merits A, Ahola T, Tammela P..Inhibitors of alphavirus entry and replication identified with a stable Chikungunya replicon cell li.PLoS One. 2011;6(12):e28923. doi: 10.1371/journal.pone.0028923. Epub 2011 Dec 19. PMID:22205980
|  |
|
Comment | This approach for discovering alphaviral inhibitors enabled us to identify potential lead structures for the development of alphavirus entry and replication phase inhibitors as well as demonstrated the usefulness of CHIKV replicon and SFV as biosafe surrogate models for anti-CHIKV screening
| |