| Chemical Information | |
| Antiviral agent ID | DrugRepV_2943 | |
| Antiviral agent name | Chloroquine |  |
| IUPAC Name | 4-N-(7-chloroquinolin-4-yl)-1-N,1-N-diethylpentane-1,4-diamine |  |
| SMILES (canonical) | CCN(CC)CCCC(C)NC1=C2C=CC(=CC2=NC=C1)Cl | |
| Molecular Formula | C18H26ClN3 | |
| Molecular Weight (g/mol) | 319.877 | |
| InChl | InChI=1S/C18H26ClN3/c1-4-22(5-2)12-6-7-14(3)21-17-10-11-20-18-13-15(19)8-9-16(17)18/h8-11,13-14H,4-7,12H2,1-3H3,(H,20,21) | |
| Common Name | Chloroquine | |
| Synonyms | Chloraquine | Chlorochin | Chloroquina | Chloroquine | Chloroquinium | Chloroquinum | Cloroquina | N4-(7-chloro-4-quinolinyl)-N1,N1-diethyl-1,4-pentanediamine | |
| Structural Information | |
 |
|
| Clinical Information | |
|
Category | Antiparasitic products, Insectisides and Repellents
| |
|
Primary Indication (Clinical trial phases) | Approved
|  |
| Biological Information | |
|
Primary Indication (Disease Category) | Infectious Disease
| |
|
Primary Indication (Disease) | Malaria
| |
|
Primary Indication (Drug target/Mode of Action) | Glypican 3 isoform 2
| |
|
Secondary Indication | Chikungunya virus (CHIKV) NA DRDE-06 |   |
|
Secondary Indication (Approaches) | Experimental | |
| Secondary Indication (Methods) | In-vitro | |
|
Secondary Indication (Potential drug target) | Inhibit the pH-dependent steps
| |
|
Secondary Indication (Model system) [cell lines/ animal models] | Vero
| |
|
Secondary Indication (Mode of viral infection) | Adsorption
| |
|
Secondary Indication (Viral titer) | 100000000 pfu/ml
| |
|
Secondary Indication (Mode of drug delivery) | Culture
| |
|
Secondary Indication (Time of drug delivery) | Post infection (1 hour)
| |
|
Secondary Indication (Duration of drug delivery) | 36 hours
| |
|
Secondary Indication (Drug concentration) | 20 μM
| |
|
Secondary Indication (Cell based assay) | Plaque assay
| |
|
Secondary Indication (Change) | Decrease
| |
|
Secondary Indication (Type of Inhibition) | Log reduction [ 3 logs ] | |
|
Reference | Khan M, Santhosh SR, Tiwari M, Lakshmana Rao PV, Parida M..Assessment of in vitro prophylactic and therapeutic efficacy of chloroquine against Chikungunya viru.J Med Virol. 2010 May;82(5):817-24. doi: 10.1002/jmv.21663. PMID:20336760
|  |
|
Comment | Chloroquine diminished CHIKV infection in a dose-dependent manner, with an effective concentration range of 5 ‰ÛÒ 20 ?M
| |