| Chemical Information | |
| Antiviral agent ID | DrugRepV_2516 | |
| Antiviral agent name | Ketotifen Fumarate |  |
| IUPAC Name | (E)-but-2-enedioic acid;10-(1-methylpiperidin-4-ylidene)-5H-benzo[1,2]cyclohepta[3,4-b]thiophen-4-one |  |
| SMILES (canonical) | CN1CCC(=C2C3=C(C(=O)CC4=CC=CC=C42)SC=C3)CC1.C(=CC(=O)O)C(=O)O | |
| SMILES (isomeric) | CN1CCC(=C2C3=C(C(=O)CC4=CC=CC=C42)SC=C3)CC1.C(=C/C(=O)O)\C(=O)O | |
| Molecular Formula | C23H23NO5S | |
| Molecular Weight (g/mol) | 425.499 | |
| InChl | InChI=1S/C19H19NOS.C4H4O4/c1-20-9-6-13(7-10-20)18-15-5-3-2-4-14(15)12-17(21)19-16(18)8-11-22-19;5-3(6)1-2-4(7)8/h2-5,8,11H,6-7,9-10,12H2,1H3;1-2H,(H,5,6)(H,7,8)/b;2-1+ | |
| Synonyms | Ketotifen hydrogen fumarate | Ketotifen (fumarate) | HC 20511 fumarate | |
| Structural Information | |
 |
|
| Clinical Information | |
|
Category | Respiratory System
| |
|
Primary Indication (Clinical trial phases) | Approved
|  |
| Biological Information | |
|
Primary Indication (Disease Category) | Non Infectious Disease
| |
|
Primary Indication (Disease) | Atopic asthma | Conjunctivitis
| |
|
Secondary Indication | Chikungunya virus (CHIKV) NA vAc-CHIKV 26S-Rhir-E |   |
|
Secondary Indication (Approaches) | Experimental | |
| Secondary Indication (Methods) | in-vitro | |
|
Secondary Indication (Model system) [cell lines/ animal models] | Sf21
| |
|
Secondary Indication (Mode of viral infection) | Adsorption
| |
|
Secondary Indication (Viral titer) | 2 MOI
| |
|
Secondary Indication (Mode of drug delivery) | Culture
| |
|
Secondary Indication (Drug concentration) | 100 μM
| |
|
Secondary Indication (Cell based assay) | Fusion index-Fluorescent Intensities
| |
|
Secondary Indication (Change) | Increase
| |
|
Secondary Indication (Type of Inhibition) | Percentage inhibition [ -0.1370416 % ] | |
|
Reference | Wang YM, Lu JW, Lin CC, Chin YF, Wu TY, Lin LI, Lai ZZ, Kuo SC, Ho YJ..Antiviral activities of niclosamide and nitazoxanide against chikungunya virus entry and transmissio.Antiviral Res. 2016 Nov;135:81-90. doi: 10.1016/j.antiviral.2016.10.003. Epub 2016 Oct 11. PMID:27742486
|  |
|
Comment | Niclosamide and nitazoxanide were able to inhibit CHIKV entry and transmission, which might provide a basis for the development of novel human drug therapies against CHIKV and other alphavirus infections.
| |