| Chemical Information | |
| Antiviral agent ID | DrugRepV_2047 | |
| Antiviral agent name | Cilnidipine |  |
| IUPAC Name | 3-O-(2-methoxyethyl) 5-O-[(E)-3-phenylprop-2-enyl] 2,6-dimethyl-4-(3-nitrophenyl)-1,4-dihydropyridine-3,5-dicarboxylate |  |
| SMILES (canonical) | CC1=C(C(C(=C(N1)C)C(=O)OCC=CC2=CC=CC=C2)C3=CC(=CC=C3)[N+](=O)[O-])C(=O)OCCOC | |
| SMILES (isomeric) | CC1=C(C(C(=C(N1)C)C(=O)OC/C=C/C2=CC=CC=C2)C3=CC(=CC=C3)[N+](=O)[O-])C(=O)OCCOC | |
| Molecular Formula | C27H28N2O7 | |
| Molecular Weight (g/mol) | 492.528 | |
| InChl | InChI=1S/C27H28N2O7/c1-18-23(26(30)35-14-8-11-20-9-5-4-6-10-20)25(21-12-7-13-22(17-21)29(32)33)24(19(2)28-18)27(31)36-16-15-34-3/h4-13,17,25,28H,14-16H2,1-3H3/b11-8+ | |
| Common Name | Cilnidipine | |
| Synonyms | Cinalong | FRC 8653 | Siscard | Atelec | |
| Structural Information | |
 |
|
| Clinical Information | |
|
Category | Cardiovascular agents
| |
|
Primary Indication (Clinical trial phases) | Approved
|  |
| Biological Information | |
|
Primary Indication (Disease Category) | Non Infectious Disease
| |
|
Primary Indication (Disease) | Hypertension
| |
|
Secondary Indication | Middle East respiratory syndrome coronavirus (MERS-CoV) NA EMC/2012 |   |
|
Secondary Indication (Approaches) | Experimental | |
| Secondary Indication (Methods) | in-vitro | |
|
Secondary Indication (Model system) [cell lines/ animal models] | Huh-7
| |
|
Secondary Indication (Mode of viral infection) | Adsorption
| |
|
Secondary Indication (Viral titer) | 0.005 MOI
| |
|
Secondary Indication (Mode of drug delivery) | Culture
| |
|
Secondary Indication (Time of drug delivery) | During inoculation
| |
|
Secondary Indication (Duration of drug delivery) | 2 days
| |
|
Secondary Indication (Drug concentration) | 62.5 μM
| |
|
Secondary Indication (Cell based assay) | Cell viability assay
| |
|
Secondary Indication (Change) | Decrease
| |
|
Secondary Indication (Type of Inhibition) | Relative viability [ 60 % ] | |
|
Secondary Indication (Cytotoxicity) | >50 μM | |
|
Reference | De Wilde AH, Jochmans D, Posthuma CC, Zevenhoven-Dobbe JC, van Nieuwkoop S, Bestebroer TM, van den H.Screening of an FDA-approved compound library identifies four small-molecule inhibitors of Middle Ea.Antimicrob Agents Chemother. 2014 Aug;58(8):4875-84. doi: 10.1128/AAC.03011-14. Epub 2014 May 19. PMID:24841269
|  |
|
Comment | Chloroquine, chlorpromazine, loperamide, and lopinavir inhibiting MERS-CoV replication in the low-micromolar range EC(50)s, 3 to 8 ?M. Moreover, these compounds also inhibit the replication of SARS coronavirus and human coronavirus 229E.
| |