| Chemical Information | |
| Antiviral agent ID | DrugRepV_2022 | |
| Antiviral agent name | Securinine | |
| IUPAC Name | (1S,2R,8S)-14-Oxa-7-azatetracyclo[6.6.1.0~1,11~.0~2,7~]pentadeca-9,11-dien-13-one |  |
| SMILES (canonical) | C1CCN2C(C1)C34CC2C=CC3=CC(=O)O4 | |
| SMILES (isomeric) | C1CCN2[C@H](C1)[C@]34C[C@H]2C=CC3=CC(=O)O4 | |
| Molecular Formula | C13H15NO2 | |
| Molecular Weight (g/mol) | 217.268 | |
| InChl | InChI=1S/C13H15NO2/c15-12-7-9-4-5-10-8-13(9,16-12)11-3-1-2-6-14(10)11/h4-5,7,10-11H,1-3,6,8H2/t10-,11-,13+/m1/s1 | |
| Structural Information | |
 |
|
| Clinical Information | |
|
Category | Anticancer
| |
| Biological Information | |
|
Secondary Indication | Ebola virus (EBOV) NA Zaire strain-pEBOV |   |
|
Secondary Indication (Approaches) | Experimental | |
| Secondary Indication (Methods) | In-vitro | |
|
Secondary Indication (Model system) [cell lines/ animal models] | Vero
| |
|
Secondary Indication (Mode of viral infection) | Adsorption
| |
|
Secondary Indication (Mode of drug delivery) | Culture
| |
|
Secondary Indication (Time of drug delivery) | Pre infection
| |
|
Secondary Indication (Duration of drug delivery) | 72 hours
| |
|
Secondary Indication (Drug concentration) | 27.11 μM
| |
|
Secondary Indication (Cell based assay) | Firefly luciferase assay
| |
|
Secondary Indication (Change) | Decrease
| |
|
Secondary Indication (Type of Inhibition) | EC50 [ 50 % ] | |
|
Secondary Indication (Cytotoxicity) | 113.58 μM | |
|
Reference | Wang Y, Cui R, Li G, Gao Q, Yuan S, Altmeyer R, Zou G..Teicoplanin inhibits Ebola pseudovirus infection in cell culture..Antiviral Res. 2016 Jan;125:1-7. doi: 10.1016/j.antiviral.2015.11.003. Epub 2015 Nov 14. PMID:26585243
|  |
|
Comment | Glycopeptide antibiotic teicoplanin inhibiting Ebola pseudovirus infection by blocking virus entry in the low micromolar range
| |