| Chemical Information | |
| Antiviral agent ID | DrugRepV_1994 | |
| Antiviral agent name | Hydroxychloroquine Sulfate |  |
| IUPAC Name | 2-[4-[(7-chloroquinolin-4-yl)amino]pentyl-ethylamino]ethanol;sulfuric acid |  |
| SMILES (canonical) | CCN(CCCC(C)NC1=C2C=CC(=CC2=NC=C1)Cl)CCO.OS(=O)(=O)O | |
| Molecular Formula | C18H28ClN3O5S | |
| Molecular Weight (g/mol) | 433.95 | |
| InChl | InChI=1S/C18H26ClN3O.H2O4S/c1-3-22(11-12-23)10-4-5-14(2)21-17-8-9-20-18-13-15(19)6-7-16(17)18;1-5(2,3)4/h6-9,13-14,23H,3-5,10-12H2,1-2H3,(H,20,21);(H2,1,2,3,4) | |
| Synonyms | 2-((4-((7-Chloroquinolin-4-yl)amino)pentyl)(ethyl)amino)ethanol sulfate | 2-((4-((7-chloroquinolin-4-yl)amino)pentyl)(ethyl)amino)ethan-1-ol sulfate | Ethanol, monosulfate | hydroxychloroquine; sulfuric acid | |
| Structural Information | |
 |
|
| Clinical Information | |
|
Category | Antiparasitic products, Insectisides and Repellents
| |
|
Primary Indication (Clinical trial phases) | Approved
|  |
| Biological Information | |
|
Primary Indication (Disease Category) | Infectious Disease
| |
|
Primary Indication (Disease) | Malaria
| |
|
Secondary Indication | Severe acute respiratory syndrome coronavirus (SARS-CoV) NA NA |   |
|
Secondary Indication (Approaches) | Experimental-HTS | |
| Secondary Indication (Methods) | in-vitro | |
|
Secondary Indication (Model system) [cell lines/ animal models] | VeroE6
| |
|
Secondary Indication (Mode of viral infection) | Adsorption
| |
|
Secondary Indication (Viral titer) | 1 MOI
| |
|
Secondary Indication (Mode of drug delivery) | Culture
| |
|
Secondary Indication (Time of drug delivery) | Pre infection (1 hour)
| |
|
Secondary Indication (Duration of drug delivery) | 48 hours
| |
|
Secondary Indication (Drug concentration) | 7.966 μM
| |
|
Secondary Indication (Cell based assay) | Cytopathic effect (CPE) assay
| |
|
Secondary Indication (Change) | Decrease
| |
|
Secondary Indication (Type of Inhibition) | EC50 [ 50 % ] | |
|
Reference | Dyall J, Coleman CM, Hart BJ, Venkataraman T, Holbrook MR, Kindrachuk J, Johnson RF, Olinger GG Jr,.Repurposing of clinically developed drugs for treatment of Middle East respiratory syndrome coronavi.Antimicrob Agents Chemother. 2014 Aug;58(8):4885-93. doi: 10.1128/AAC.03036-14. Epub 2014 May 19. PMID:24841273
|  |
|
Comment | Drugs identified in these screens provide new targets for in vivo studies as well as incorporation into ongoing clinical studies.
| |