| Chemical Information | |
| Antiviral agent ID | DrugRepV_1947 | |
| Antiviral agent name | Nitazoxanide |  |
| IUPAC Name | [2-[(5-nitro-1,3-thiazol-2-yl)carbamoyl]phenyl] acetate |  |
| SMILES (canonical) | CC(=O)OC1=CC=CC=C1C(=O)NC2=NC=C(S2)[N+](=O)[O-] | |
| Molecular Formula | C12H9N3O5S | |
| Molecular Weight (g/mol) | 307.28 | |
| InChl | InChI=1S/C12H9N3O5S/c1-7(16)20-9-5-3-2-4-8(9)11(17)14-12-13-6-10(21-12)15(18)19/h2-6H,1H3,(H,13,14,17) | |
| Structural Information | |
 |
|
| Clinical Information | |
|
Category | Antiparasitic products, Insectisides and Repellents
| |
|
Primary Indication (Clinical trial phases) | Approved, Investigational, Vet approved
|  |
| Biological Information | |
|
Primary Indication (Disease Category) | Infectious Disease
| |
|
Primary Indication (Disease) | Diarrhea
| |
|
Secondary Indication | Zika virus (ZIKV) NA SZ-WIV01 |   |
|
Secondary Indication (Approaches) | Experimental | |
| Secondary Indication (Methods) | In-vitro | |
|
Secondary Indication (Potential drug target) | Host Factor- depleting intracellular Ca2+ stores
| |
|
Secondary Indication (Model system) [cell lines/ animal models] | Vero
| |
|
Secondary Indication (Mode of viral infection) | Adsorption
| |
|
Secondary Indication (Viral titer) | 0.1 MOI
| |
|
Secondary Indication (Mode of drug delivery) | Culture
| |
|
Secondary Indication (Time of drug delivery) | Post infection
| |
|
Secondary Indication (Duration of drug delivery) | 48 hours
| |
|
Secondary Indication (Drug concentration) | 10 μM
| |
|
Secondary Indication (Cell based assay) | Real-time PCR
| |
|
Secondary Indication (Change) | Decrease
| |
|
Secondary Indication (Type of Inhibition) | Relative intracellular RNA level [ 20 NA ] | |
|
Reference | Cao RY, Xu YF, Zhang TH, Yang JJ, Yuan Y, Hao P, Shi Y, Zhong J, Zhong W..Pediatric Drug Nitazoxanide: A Potential Choice for Control of Zika..Open Forum Infect Dis. 2017 Feb 3;4(1):ofx009. doi: 10.1093/ofid/ofx009. eCollection 2017 Winter. PMID:28480282
|  |
|
Comment | Nitazoxanide and its bioactive metabolite, tizoxanide have anti-ZIKV potential in vitro and exerts antiviral effect possibly by targeting the viral postattachment step.
| |