| Chemical Information | |
| Antiviral agent ID | DrugRepV_1886 | |
| Antiviral agent name | Niclosamide |  |
| IUPAC Name | 5-chloro-N-(2-chloro-4-nitrophenyl)-2-hydroxybenzamide |  |
| SMILES (canonical) | C1=CC(=C(C=C1[N+](=O)[O-])Cl)NC(=O)C2=C(C=CC(=C2)Cl)O | |
| Molecular Formula | C13H8Cl2N2O4 | |
| Molecular Weight (g/mol) | 327.117 | |
| InChl | InChI=1S/C13H8Cl2N2O4/c14-7-1-4-12(18)9(5-7)13(19)16-11-3-2-8(17(20)21)6-10(11)15/h1-6,18H,(H,16,19) | |
| Common Name | Niclosamide | |
| Synonyms | Bayluscid | Niclocide | Phenasal | Tredemine | Fenasal | |
| Structural Information | |
 |
|
| Clinical Information | |
|
Category | Antiparasitic products, Insectisides and Repellents
| |
|
Primary Indication (Clinical trial phases) | Approved
|  |
| Biological Information | |
|
Primary Indication (Disease Category) | Infectious Disease
| |
|
Primary Indication (Disease) | Tapeworm and intestinal fluke infections | Helminthiasis
| |
|
Primary Indication (Drug target/Mode of Action) | Beta-microseminoprotein
| |
|
Secondary Indication | Zika virus (ZIKV) NA FSS13025 |   |
|
Secondary Indication (Approaches) | Experimental | |
| Secondary Indication (Methods) | In-vitro | |
|
Secondary Indication (Model system) [cell lines/ animal models] | SNB-19 glioblastoma
| |
|
Secondary Indication (Mode of viral infection) | Adsorption
| |
|
Secondary Indication (Viral titer) | 1 MOI
| |
|
Secondary Indication (Mode of drug delivery) | Culture
| |
|
Secondary Indication (Time of drug delivery) | Pre infection (1 hour)
| |
|
Secondary Indication (Duration of drug delivery) | 48 hours
| |
|
Secondary Indication (Drug concentration) | 2 μM
| |
|
Secondary Indication (Cell based assay) | Real-time PCR
| |
|
Secondary Indication (Change) | Decrease
| |
|
Secondary Indication (Type of Inhibition) | Relative RNA level [ 0.4 NA ] | |
|
Reference | Xu M, Lee EM, Wen Z, Cheng Y, Huang WK, Qian X, Tcw J, Kouznetsova J, Ogden SC, Hammack C, Jacob F,.Identification of small-molecule inhibitors of Zika virus infection and induced neural cell death via a drug repurposing screen.Nat Med. 2016 Oct;22(10):1101-1107. doi: 10.1038/nm.4184. Epub 2016 Aug 29. PMID:27571349
|  |
|
Comment | The identified compounds that either inhibit ZIKV infection or suppress infection-induced caspase-3 activity in different neural cells
| |