| Chemical Information | |
| Antiviral agent ID | DrugRepV_1828 | |
| Antiviral agent name | Pirarubicin |  |
| IUPAC Name | (7S,9S)-7-[(2R,4S,5S,6S)-4-amino-6-methyl-5-[(2S)-oxan-2-yl]oxyoxan-2-yl]oxy-6,9,11-trihydroxy-9-(2-hydroxyacetyl)-4-methoxy-8,10-dihydro-7H-tetracene-5,12-dione |  |
| SMILES (canonical) | CC1C(C(CC(O1)OC2CC(CC3=C(C4=C(C(=C23)O)C(=O)C5=C(C4=O)C=CC=C5OC)O)(C(=O)CO)O)N)OC6CCCCO6 | |
| SMILES (isomeric) | C[C@H]1[C@H]([C@H](C[C@@H](O1)O[C@H]2C[C@@](CC3=C(C4=C(C(=C23)O)C(=O)C5=C(C4=O)C=CC=C5OC)O)(C(=O)CO)O)N)O[C@H]6CCCCO6 | |
| Molecular Formula | C32H37NO12 | |
| Molecular Weight (g/mol) | 627.643 | |
| InChl | InChI=1S/C32H37NO12/c1-14-31(45-21-8-3-4-9-42-21)17(33)10-22(43-14)44-19-12-32(40,20(35)13-34)11-16-24(19)30(39)26-25(28(16)37)27(36)15-6-5-7-18(41-2)23(15)29(26)38/h5-7,14,17,19,21-22,31,34,37,39-40H,3-4,8-13,33H2,1-2H3/t14-,17-,19-,21-,22-,31+,32-/m0/s1 | |
| Common Name | Pirarubicin | |
| Synonyms | Adriamycin, tetrahydropyranyl | Theprubicin | THP-Adm | THP-Doxorubicin | |
| Structural Information | |
 |
|
| Clinical Information | |
|
Category | Antineoplastic and Immunomodulating Agents
| |
|
Primary Indication (Clinical trial phases) | Investigational
|  |
| Biological Information | |
|
Primary Indication (Disease Category) | Non Infectious Disease
| |
|
Primary Indication (Disease) | Cancer
| |
|
Secondary Indication | Zika virus (ZIKV) NA MR766 |   |
|
Secondary Indication (Approaches) | Experimental-HTS | |
| Secondary Indication (Methods) | In-vitro | |
|
Secondary Indication (Model system) [cell lines/ animal models] | hNPCs
| |
|
Secondary Indication (Mode of viral infection) | Adsorption
| |
|
Secondary Indication (Viral titer) | 1 MOI
| |
|
Secondary Indication (Mode of drug delivery) | Culture
| |
|
Secondary Indication (Cell based assay) | Cell viability assay
| |
|
Secondary Indication (Change) | No significant effect
| |
|
Secondary Indication (Cytotoxicity) | NA Yes | |
|
Reference | Xu M, Lee EM, Wen Z, Cheng Y, Huang WK, Qian X, Tcw J, Kouznetsova J, Ogden SC, Hammack C, Jacob F,.Identification of small-molecule inhibitors of Zika virus infection and induced neural cell death via a drug repurposing screen.Nat Med. 2016 Oct;22(10):1101-1107. doi: 10.1038/nm.4184. Epub 2016 Aug 29. PMID:27571349
|  |
|
Comment | The identified compounds that either inhibit ZIKV infection or suppress infection-induced caspase-3 activity in different neural cells
| |