| Chemical Information | |
| Antiviral agent ID | DrugRepV_1827 | |
| Antiviral agent name | Piperine |  |
| IUPAC Name | (2E,4E)-5-(1,3-benzodioxol-5-yl)-1-piperidin-1-ylpenta-2,4-dien-1-one |  |
| SMILES (canonical) | C1CCN(CC1)C(=O)C=CC=CC2=CC3=C(C=C2)OCO3 | |
| SMILES (isomeric) | C1CCN(CC1)C(=O)/C=C/C=C/C2=CC3=C(C=C2)OCO3 | |
| Molecular Formula | C17H19NO3 | |
| Molecular Weight (g/mol) | 285.343 | |
| InChl | InChI=1S/C17H19NO3/c19-17(18-10-4-1-5-11-18)7-3-2-6-14-8-9-15-16(12-14)21-13-20-15/h2-3,6-9,12H,1,4-5,10-11,13H2/b6-2+,7-3+ | |
| Structural Information | |
 |
|
| Clinical Information | |
|
Category | Anticancer
| |
|
Primary Indication (Clinical trial phases) | Investigational
|  |
| Biological Information | |
|
Primary Indication (Disease Category) | Non Infectious Disease
| |
|
Primary Indication (Disease) | Multiple Myeloma | Deglutition Disorders
| |
|
Secondary Indication | Zika virus (ZIKV) NA MR766 |   |
|
Secondary Indication (Approaches) | Experimental-HTS | |
| Secondary Indication (Methods) | In-vitro | |
|
Secondary Indication (Model system) [cell lines/ animal models] | hNPCs
| |
|
Secondary Indication (Mode of viral infection) | Adsorption
| |
|
Secondary Indication (Viral titer) | 1 MOI
| |
|
Secondary Indication (Mode of drug delivery) | Culture
| |
|
Secondary Indication (Cell based assay) | Cell viability assay
| |
|
Secondary Indication (Change) | No significant effect
| |
|
Secondary Indication (Cytotoxicity) | NA Yes | |
|
Reference | Xu M, Lee EM, Wen Z, Cheng Y, Huang WK, Qian X, Tcw J, Kouznetsova J, Ogden SC, Hammack C, Jacob F,.Identification of small-molecule inhibitors of Zika virus infection and induced neural cell death via a drug repurposing screen.Nat Med. 2016 Oct;22(10):1101-1107. doi: 10.1038/nm.4184. Epub 2016 Aug 29. PMID:27571349
|  |
|
Comment | The identified compounds that either inhibit ZIKV infection or suppress infection-induced caspase-3 activity in different neural cells
| |