| Chemical Information | |
| Antiviral agent ID | DrugRepV_1610 | |
| Antiviral agent name | Sorafenib |  |
| IUPAC Name | 4-[4-[[4-chloro-3-(trifluoromethyl)phenyl]carbamoylamino]phenoxy]-N-methylpyridine-2-carboxamide |  |
| SMILES (canonical) | CNC(=O)C1=NC=CC(=C1)OC2=CC=C(C=C2)NC(=O)NC3=CC(=C(C=C3)Cl)C(F)(F)F | |
| Molecular Formula | C21H16ClF3N4O3 | |
| Molecular Weight (g/mol) | 464.829 | |
| InChl | InChI=1S/C21H16ClF3N4O3/c1-26-19(30)18-11-15(8-9-27-18)32-14-5-2-12(3-6-14)28-20(31)29-13-4-7-17(22)16(10-13)21(23,24)25/h2-11H,1H3,(H,26,30)(H2,28,29,31) | |
| Synonyms | Nexavar | 9ZOQ3TZI87 | S4-(4-((((4-Chloro-3-(trifluoromethyl)phenyl)amino)carbonyl)amino)phenoxy)-N-methyl-2-pyridinecarboxamide | N-(4-Chloro-3-(trifluoromethyl)phenyl)-n'-(4-(2-(N-methylcarbamoyl)-4-pyridyloxy)phenyl)urea | Sorafenibum | BAX | |
| Structural Information | |
 |
|
| Clinical Information | |
|
Category | Antineoplastic and Immunomodulating Agents
| |
|
Primary Indication (Clinical trial phases) | Approved, Investigational
|  |
| Biological Information | |
|
Primary Indication (Disease Category) | Non Infectious Disease
| |
|
Primary Indication (Disease) | Hepatocellular carcinoma | Renal cell carcinoma
| |
|
Secondary Indication | Rift Valley fever virus (RVFV) NA ZH501 |   |
|
Secondary Indication (Approaches) | Experimental | |
| Secondary Indication (Methods) | In-vivo | |
|
Secondary Indication (Potential drug target) | Late stage in virus infection and caused a buildup of virions within cells
| |
|
Secondary Indication (Model system) [cell lines/ animal models] | BALB/c mice
| |
|
Secondary Indication (Mode of viral infection) | Subcutaneous
| |
|
Secondary Indication (Viral titer) | 1000 PFU
| |
|
Secondary Indication (Mode of drug delivery) | Oral
| |
|
Secondary Indication (Time of drug delivery) | Post infection
| |
|
Secondary Indication (Duration of drug delivery) | 14 days
| |
|
Secondary Indication (Drug concentration) | 30 mg/kg
| |
|
Secondary Indication (Cell based assay) | Survival assay
| |
|
Secondary Indication (Change) | No significant effect
| |
|
Secondary Indication (Survival rate) | 14 days -30% survival rate | |
|
Reference | Benedict A, Bansal N, Senina S, Hooper I, Lundberg L, de la Fuente C, Narayanan A, Gutting B, Kehn-H.Repurposing FDA-approved drugs as therapeutics to treat Rift Valley fever virus infection..Front Microbiol. 2015 Jul 8;6:676. doi: 10.3389/fmicb.2015.00676. eCollection 2015. PMID:26217313
|  |
|
Comment | siRNA knockdown of Raf proteins indicated that non-classical targets of sorafenib are likely important for the replication of RVFV.
| |