| Chemical Information | |
| Antiviral agent ID | DrugRepV_1594 | |
| Antiviral agent name | Ribavirin |  |
| IUPAC Name | 1-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-1,2,4-triazole-3-carboxamide |  |
| SMILES (canonical) | C1=NC(=NN1C2C(C(C(O2)CO)O)O)C(=O)N | |
| SMILES (isomeric) | C1=NC(=NN1[C@H]2[C@@H]([C@@H]([C@H](O2)CO)O)O)C(=O)N | |
| Molecular Formula | C8H12N4O5 | |
| Molecular Weight (g/mol) | 244.207 | |
| InChl | InChI=1S/C8H12N4O5/c9-6(16)7-10-2-12(11-7)8-5(15)4(14)3(1-13)17-8/h2-5,8,13-15H,1H2,(H2,9,16)/t3-,4-,5-,8-/m1/s1 | |
| Common Name | Ribavirin | |
| Synonyms | 1-beta-D-Ribofuranosyl-1,2,4-triazole-3-carboxamide | 1-beta-D-Ribofuranosyl-1H-1,2,4-triazole-3-carboxamide | RBV | Ribavirin | Ribavirina | Ribavirine | Ribavirinum | Tribavirin | |
| Structural Information | |
 |
|
| Clinical Information | |
|
Category | Antiinfectives For Systemic Use
| |
|
Primary Indication (Clinical trial phases) | Approved
|  |
| Biological Information | |
|
Primary Indication (Disease Category) | Infectious Disease
| |
|
Primary Indication (Disease) | Hepatitis C virus
| |
|
Primary Indication (Drug target/Mode of Action) | Potential E3 ubiquitin-protein ligase ariadne-2
| |
|
Secondary Indication | Rift Valley fever virus (RVFV) NA rMP12 |   |
|
Secondary Indication (Approaches) | Experimental | |
| Secondary Indication (Methods) | In-vitro | |
|
Secondary Indication (Potential drug target) | Late stage in virus infection and caused a buildup of virions within cells
| |
|
Secondary Indication (Model system) [cell lines/ animal models] | HSAEC
| |
|
Secondary Indication (Mode of viral infection) | Adsorption
| |
|
Secondary Indication (Viral titer) | 0.1 MOI
| |
|
Secondary Indication (Mode of drug delivery) | Culture
| |
|
Secondary Indication (Time of drug delivery) | Post infection
| |
|
Secondary Indication (Duration of drug delivery) | 24 hours
| |
|
Secondary Indication (Drug concentration) | 82 μM
| |
|
Secondary Indication (Cell based assay) | Plaque assay
| |
|
Secondary Indication (Change) | Decrease
| |
|
Secondary Indication (Type of Inhibition) | Log Reduction [ 4.5 Logs reduction ] | |
|
Reference | Benedict A, Bansal N, Senina S, Hooper I, Lundberg L, de la Fuente C, Narayanan A, Gutting B, Kehn-H.Repurposing FDA-approved drugs as therapeutics to treat Rift Valley fever virus infection..Front Microbiol. 2015 Jul 8;6:676. doi: 10.3389/fmicb.2015.00676. eCollection 2015. PMID:26217313
|  |
|
Comment | Displayed intracellular infectivity. siRNA knockdown of Raf proteins indicated that non-classical targets of sorafenib are likely important for the replication of RVFV.
| |