| Chemical Information | |
| Antiviral agent ID | DrugRepV_1329 | |
| Antiviral agent name | Mesalamine |  |
| IUPAC Name | 5-amino-2-hydroxybenzoic acid |  |
| SMILES (canonical) | C1=CC(=C(C=C1N)C(=O)O)O | |
| Molecular Formula | C7H7NO3 | |
| Molecular Weight (g/mol) | 153.14 | |
| InChl | InChI=1S/C7H7NO3/c8-4-1-2-6(9)5(3-4)7(10)11/h1-3,9H,8H2,(H,10,11) | |
| Common Name | Mesalazine | |
| Synonyms | 3-carboxy-4-hydroxyaniline | 5-aminosalicylic acid | 5-ASA | m-Aminosalicylic acid | Mesalamine | Mesalazina | Mésalazine | Mesalazinum | p-Aminosalicylsaeure | |
| Structural Information | |
 |
|
| Clinical Information | |
|
Category | Alimentary Tract and Metabolism
| |
|
Primary Indication (Clinical trial phases) | Approved
|  |
| Biological Information | |
|
Primary Indication (Disease Category) | Non Infectious Disease
| |
|
Primary Indication (Disease) | Ulcerative colitis
| |
|
Secondary Indication | Zika virus (ZIKV) NA MEX_I_7 |   |
|
Secondary Indication (Approaches) | Experimental-HTS | |
| Secondary Indication (Methods) | In-vitro | |
|
Secondary Indication (Model system) [cell lines/ animal models] | Huh-7
| |
|
Secondary Indication (Mode of viral infection) | Adsorption
| |
|
Secondary Indication (Viral titer) | 0.4 MOI
| |
|
Secondary Indication (Mode of drug delivery) | Culture
| |
|
Secondary Indication (Time of drug delivery) | Pre infection (1 hour)
| |
|
Secondary Indication (Duration of drug delivery) | 24-26 hours
| |
|
Secondary Indication (Drug concentration) | 13.8 μM
| |
|
Secondary Indication (Cell based assay) | Fluorescence-based assay
| |
|
Secondary Indication (Change) | Decrease
| |
|
Secondary Indication (Type of Inhibition) | Percentage Inhibition [ 46.935 % ] | |
|
Reference | Barrows NJ, Campos RK, Powell ST, Prasanth KR, Schott-Lerner G, Soto-Acosta R, Galarza-Muñoz.A Screen of FDA-Approved Drugs for Inhibitors of Zika Virus Infection..Cell Host Microbe. 2016 Aug 10;20(2):259-70. doi: 10.1016/j.chom.2016.07.004. Epub 2016 Jul 28. PMID:27476412
|  |
|
Comment | Several drugs reduced ZIKV infection across multiple cell types. This study identifies drugs that could be tested in clinical studies of ZIKV infection and provides a resource of small molecules to study ZIKV pathogenesis.
| |