| Chemical Information | |
| Antiviral agent ID | DrugRepV_1185 | |
| Antiviral agent name | Isosorbide Dinitrate |  |
| IUPAC Name | [(3S,3aS,6R,6aS)-3-nitrooxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl] nitrate |  |
| SMILES (canonical) | C1C(C2C(O1)C(CO2)O[N+](=O)[O-])O[N+](=O)[O-] | |
| SMILES (isomeric) | C1[C@H]([C@@H]2[C@H](O1)[C@H](CO2)O[N+](=O)[O-])O[N+](=O)[O-] | |
| Molecular Formula | C6H8N2O8 | |
| Molecular Weight (g/mol) | 236.14 | |
| InChl | InChI=1S/C6H8N2O8/c9-7(10)15-3-1-13-6-4(16-8(11)12)2-14-5(3)6/h3-6H,1-2H2/t3-,4+,5-,6-/m1/s1 | |
| Common Name | Isosorbide Dinitrate | |
| Synonyms | 1,4:3,6-Dianhydrosorbitol 2,5-dinitrate | Carvasin | D-Isosorbide dinitrate | Dianhydrosorbitol 2,5-dinitrate | Dinitrate d'isosorbide | Dinitrato de isosorbida | Dinitroisosorbide | Dinitrosorbide | Flindix | ISDN | Isorbid | Isosorbide 2,5-dinitrate | Isosorbide dinitrate | Isosorbidi dinitras | Nitrosorbide | Sorbide nitrate | Sorbidilat | Sorbidnitrate | |
| Structural Information | |
 |
|
| Clinical Information | |
|
Category | Cardiovascular agents
| |
|
Primary Indication (Clinical trial phases) | Approved, Investigational
|  |
| Biological Information | |
|
Primary Indication (Disease Category) | Non Infectious Disease
| |
|
Primary Indication (Disease) | Angina pectoris (Coronary artery disease)
| |
|
Primary Indication (Drug target/Mode of Action) | Transcription initiation factor TFIID subunit 12
| |
|
Secondary Indication | Zika virus (ZIKV) NA MEX_I_7 |   |
|
Secondary Indication (Approaches) | Experimental-HTS | |
| Secondary Indication (Methods) | In-vitro | |
|
Secondary Indication (Model system) [cell lines/ animal models] | Huh-7
| |
|
Secondary Indication (Mode of viral infection) | Adsorption
| |
|
Secondary Indication (Viral titer) | 0.4 MOI
| |
|
Secondary Indication (Mode of drug delivery) | Culture
| |
|
Secondary Indication (Time of drug delivery) | Pre infection (1 hour)
| |
|
Secondary Indication (Duration of drug delivery) | 24-26 hours
| |
|
Secondary Indication (Drug concentration) | 13.8 μM
| |
|
Secondary Indication (Cell based assay) | Fluorescence-based assay
| |
|
Secondary Indication (Change) | Decrease
| |
|
Secondary Indication (Type of Inhibition) | Percentage Inhibition [ 47.66 % ] | |
|
Reference | Barrows NJ, Campos RK, Powell ST, Prasanth KR, Schott-Lerner G, Soto-Acosta R, Galarza-Muñoz.A Screen of FDA-Approved Drugs for Inhibitors of Zika Virus Infection..Cell Host Microbe. 2016 Aug 10;20(2):259-70. doi: 10.1016/j.chom.2016.07.004. Epub 2016 Jul 28. PMID:27476412
|  |
|
Comment | Several drugs reduced ZIKV infection across multiple cell types. This study identifies drugs that could be tested in clinical studies of ZIKV infection and provides a resource of small molecules to study ZIKV pathogenesis.
| |