| Chemical Information | |
| Antiviral agent ID | DrugRepV_0873 | |
| Antiviral agent name | Carbachol Chloride |  |
| IUPAC Name | 2-carbamoyloxyethyl(trimethyl)azanium;chloride |  |
| SMILES (canonical) | C[N+](C)(C)CCOC(=O)N.[Cl-] | |
| Molecular Formula | C6H15ClN2O2 | |
| Molecular Weight (g/mol) | 182.65 | |
| InChl | InChI=1S/C6H14N2O2.ClH/c1-8(2,3)4-5-10-6(7)9;/h4-5H2,1-3H3,(H-,7,9);1H | |
| Common Name | Carbachol | |
| Synonyms | (2-Carbamoyloxyethyl)trimethylammonium chloride | (2-Hydroxyethyl)trimethyl ammonium chloride carbamate | (2-Hydroxyethyl)trimethylammonium chloride carbamate | 2-((Aminocarbonyl)oxy)-N,N,N-trimethylethanaminium chloride | 2-((Aminocarbonyl)oxy)-N,N,N-trimethylethanaminum chloride | Carbachol | Carbachol chloride | Carbacholum | Carbacol | Choline carbamate chloride | Choline chloride, carbamate | Choline chlorine carbamate | Karbachol | Karbamoylcholin chlorid | |
| Structural Information | |
 |
|
| Clinical Information | |
|
Category | Sensory Organ
| |
|
Primary Indication (Clinical trial phases) | Approved
|  |
| Biological Information | |
|
Primary Indication (Disease Category) | Non Infectious Disease
| |
|
Primary Indication (Disease) | Glaucoma
| |
|
Primary Indication (Drug target/Mode of Action) | Pyrroline-5-carboxylate reductase 1, isoform CRA_c
| |
|
Secondary Indication | Zika virus (ZIKV) NA MEX_I_7 |   |
|
Secondary Indication (Approaches) | Experimental-HTS | |
| Secondary Indication (Methods) | In-vitro | |
|
Secondary Indication (Model system) [cell lines/ animal models] | Huh-7
| |
|
Secondary Indication (Mode of viral infection) | Adsorption
| |
|
Secondary Indication (Viral titer) | 0.4 MOI
| |
|
Secondary Indication (Mode of drug delivery) | Culture
| |
|
Secondary Indication (Time of drug delivery) | Pre infection (1 hour)
| |
|
Secondary Indication (Duration of drug delivery) | 24-26 hours
| |
|
Secondary Indication (Drug concentration) | 13.8 μM
| |
|
Secondary Indication (Cell based assay) | Fluorescence-based assay
| |
|
Secondary Indication (Change) | Decrease
| |
|
Secondary Indication (Type of Inhibition) | Percentage Inhibition [ 58.395 % ] | |
|
Reference | Barrows NJ, Campos RK, Powell ST, Prasanth KR, Schott-Lerner G, Soto-Acosta R, Galarza-Muñoz.A Screen of FDA-Approved Drugs for Inhibitors of Zika Virus Infection..Cell Host Microbe. 2016 Aug 10;20(2):259-70. doi: 10.1016/j.chom.2016.07.004. Epub 2016 Jul 28. PMID:27476412
|  |
|
Comment | Several drugs reduced ZIKV infection across multiple cell types. This study identifies drugs that could be tested in clinical studies of ZIKV infection and provides a resource of small molecules to study ZIKV pathogenesis.
| |