| Chemical Information | |
| Antiviral agent ID | DrugRepV_0734 | |
| Antiviral agent name | Probenecid |  |
| IUPAC Name | 4-(dipropylsulfamoyl)benzoic acid |  |
| SMILES (canonical) | CCCN(CCC)S(=O)(=O)C1=CC=C(C=C1)C(=O)O | |
| Molecular Formula | C13H19NO4S | |
| Molecular Weight (g/mol) | 285.36 | |
| InChl | InChI=1S/C13H19NO4S/c1-3-9-14(10-4-2)19(17,18)12-7-5-11(6-8-12)13(15)16/h5-8H,3-4,9-10H2,1-2H3,(H,15,16) | |
| Common Name | Probenecid | |
| Synonyms | 4-((Dipropylamino)sulfonyl)benzoic acid | 4-(Di-N-propylsulfamoyl)benzoesaeure | 4-(N,N-Dipropylsulfamoyl)benzoesaeure | P-(Dipropylsulfamoyl)benzoic acid | Probenecid acid | Probenecida | Probenecide | Probenecidum | |
| Structural Information | |
 |
|
| Clinical Information | |
|
Category | Musculo-Skeletal System
| |
|
Primary Indication (Clinical trial phases) | Approved, Investigational
|  |
| Secondary Indication (Clinical trial phases) | Phase IV | |
| Biological Information | |
|
Primary Indication (Disease Category) | Non Infectious Disease
| |
|
Primary Indication (Disease) | Gout
| |
|
Secondary Indication | Influenza virus (IAV) H1N1 A/New/ Caledonia/20/99 |   |
|
Secondary Indication (Approaches) | Experimental | |
| Secondary Indication (Methods) | In-vitro | |
|
Secondary Indication (Model system) [cell lines/ animal models] | A549
| |
|
Secondary Indication (Mode of viral infection) | Adsorption
| |
|
Secondary Indication (Viral titer) | 0.05 MOI
| |
|
Secondary Indication (Mode of drug delivery) | Culture
| |
|
Secondary Indication (Time of drug delivery) | Pre infection (24 hours)
| |
|
Secondary Indication (Duration of drug delivery) | 48 hours
| |
|
Secondary Indication (Drug concentration) | 0.000079 μM
| |
|
Secondary Indication (Cell based assay) | Fluorescence-based assay
| |
|
Secondary Indication (Change) | Decrease
| |
|
Secondary Indication (Type of Inhibition) | IC50 [ 50 % ] | |
|
Reference | Shim JS, Rao R, Beebe K, Neckers L, Han I, Nahta R, Liu JO..Selective inhibition of HER2-positive breast cancer cells by the HIV protease inhibitor nelfinavir..J Natl Cancer Inst. 2012 Oct 17;104(20):1576-90. doi: 10.1093/jnci/djs396. Epub 2012 Oct 5. PMID:23129053
|  |
|
Comment | Probenecid, a prototypical uricosuric agent and chemical inhibitor of organic anion transporters known to target OAT3, was shown to be effective in limiting influenza A virus infection in vitro and in vivo. Probenecid is widely used for treatment of gout and related hy- peruricemic disorders, has been extensively studied for pharmacokinetics and safety, and represents an excellent candidate for drug repositioning as a novel anti-influenza A chemotherapeutic.
| |