| Chemical Information | |
| Antiviral agent ID | DrugRepV_0593 | |
| Antiviral agent name | Toremifene Citrate |  |
| IUPAC Name | 2-[4-[(Z)-4-chloro-1,2-diphenylbut-1-enyl]phenoxy]-N,N-dimethylethanamine;2-hydroxypropane-1,2,3-tricarboxylic acid |  |
| SMILES (canonical) | CN(C)CCOC1=CC=C(C=C1)C(=C(CCCl)C2=CC=CC=C2)C3=CC=CC=C3.C(C(=O)O)C(CC(=O)O)(C(=O)O)O | |
| Molecular Formula | C32H36ClNO8 | |
| Molecular Weight (g/mol) | 598.09 | |
| InChl | InChI=1S/C26H28ClNO.C6H8O7/c1-28(2)19-20-29-24-15-13-23(14-16-24)26(22-11-7-4-8-12-22)25(17-18-27)21-9-5-3-6-10-21;7-3(8)1-6(13,5(11)12)2-4(9)10/h3-16H,17-20H2,1-2H3;13H,1-2H2,(H,7,8)(H,9,10)(H,11,12)/b26-25-; | |
| Common Name | Toremifene | |
| Synonyms | Fareston | Toremifene (Citrate) | NK 622 | FC 1157a | |
| Structural Information | |
 |
|
| Clinical Information | |
|
Category | Antineoplastic and Immunomodulating Agents
| |
|
Primary Indication (Clinical trial phases) | Approved, Investigational
|  |
| Biological Information | |
|
Primary Indication (Disease Category) | Non Infectious Disease
| |
|
Primary Indication (Disease) | Breast Cancer
| |
|
Secondary Indication | Ebola virus (EBOV) NA MARV |   |
|
Secondary Indication (Approaches) | Experimental | |
| Secondary Indication (Methods) | in-vitro | |
|
Secondary Indication (Model system) [cell lines/ animal models] | VeroE6
| |
|
Secondary Indication (Mode of viral infection) | Adsorption
| |
|
Secondary Indication (Viral titer) | 0.1 MOI
| |
|
Secondary Indication (Mode of drug delivery) | Culture
| |
|
Secondary Indication (Time of drug delivery) | During inoculation
| |
|
Secondary Indication (Duration of drug delivery) | 48 hours
| |
|
Secondary Indication (Drug concentration) | 5.73 μM
| |
|
Secondary Indication (Cell based assay) | Enzyme-linked immunosorbent assay
| |
|
Secondary Indication (Change) | Decrease
| |
|
Secondary Indication (Type of Inhibition) | IC50 [ 50 % ] | |
|
Secondary Indication (Cytotoxicity) | >100 μM | |
|
Reference | Johansen LM, Brannan JM, Delos SE, Shoemaker CJ, Stossel A, Lear C, Hoffstrom BG, Dewald LE, Schornb.FDA-approved selective estrogen receptor modulators inhibit Ebola virus infection..Sci Transl Med. 2013 Jun 19;5(190):190ra79. doi: 10.1126/scitranslmed.3005471. PMID:23785035
|  |
|
Comment | The clomiphene and toremifene response appeared to be an off-target effect where the compounds interfere with a step late in viral entry and likely affect the triggering of fusion. The data support the screening of readily available approved drugs to identify therapeutics for the Ebola viruses and other infectious diseases.
| |