| Chemical Information | |
| Antiviral agent ID | DrugRepV_0301 | |
| Antiviral agent name | Flavopiridol |  |
| IUPAC Name | 2-(2-chlorophenyl)-5,7-dihydroxy-8-[(3S,4R)-3-hydroxy-1-methylpiperidin-4-yl]chromen-4-one |  |
| SMILES (canonical) | CN1CCC(C(C1)O)C2=C(C=C(C3=C2OC(=CC3=O)C4=CC=CC=C4Cl)O)O | |
| SMILES (isomeric) | CN1CC[C@@H]([C@@H](C1)O)C2=C(C=C(C3=C2OC(=CC3=O)C4=CC=CC=C4Cl)O)O | |
| Molecular Formula | C21H20ClNO5 | |
| Molecular Weight (g/mol) | 401.84 | |
| InChl | InChI=1S/C21H20ClNO5/c1-23-7-6-12(17(27)10-23)19-14(24)8-15(25)20-16(26)9-18(28-21(19)20)11-4-2-3-5-13(11)22/h2-5,8-9,12,17,24-25,27H,6-7,10H2,1H3/t12-,17+/m0/s1 | |
| Common Name | Alvocidib | |
| Synonyms | Alvocidib freebase | Flavopiridol | |
| Structural Information | |
 |
|
| Clinical Information | |
|
Category | Anticancer
| |
|
Primary Indication (Clinical trial phases) | Experimental, Investigational
|  |
| Biological Information | |
|
Primary Indication (Disease Category) | Non Infectious Disease
| |
|
Primary Indication (Disease) | Esophageal cancer | Leukemia (lymphoid) | Lung cancer | Liver cancer
| |
|
Secondary Indication | Influenza virus (IAV) H3N2 A/Philippines/2/82-X79 |   |
|
Secondary Indication (Approaches) | Experimental | |
| Secondary Indication (Methods) | In-vitro | |
|
Secondary Indication (Model system) [cell lines/ animal models] | A549
| |
|
Secondary Indication (Mode of viral infection) | Adsorption
| |
|
Secondary Indication (Viral titer) | 0.01 MOI
| |
|
Secondary Indication (Mode of drug delivery) | Culture
| |
|
Secondary Indication (Time of drug delivery) | Pre infection (2 hours)
| |
|
Secondary Indication (Duration of drug delivery) | 24 hours
| |
|
Secondary Indication (Drug concentration) | 0.7 μM
| |
|
Secondary Indication (Cell based assay) | Immunoflourescence assay
| |
|
Secondary Indication (Change) | Decrease
| |
|
Secondary Indication (Type of Inhibition) | IC50 [ 50 % ] | |
|
Secondary Indication (Cytotoxicity) | >100 μM | |
|
Reference | Perwitasari O, Yan X, O'Donnell J, Johnson S, Tripp RA..Repurposing Kinase Inhibitors as Antiviral Agents to Control Influenza A Virus Replication..Assay Drug Dev Technol. 2015 Dec;13(10):638-49. doi: 10.1089/adt.2015.0003.drrr. Epub 2015 Jul 20. PMID:26192013
|  |
|
Comment | The treatment of human A549 cells with kinase inhibitors dinaciclib, flavopiridol, or PIK-75 exhibits potent antiviral activity against H7N9 IAV as well as other IAV strains. Thus, targeting host kinases can provide a broad-spectrum therapeutic approach against IAV. These findings provide a path forward for repurposing existing kinase inhibitors safely as potential antivirals, particularly those that can be tested in vivo and ultimately for clinical use.
| |