| Chemical Information | |
| Antiviral agent ID | DrugRepV_0031 | |
| Antiviral agent name | Nitazoxanide |  |
| IUPAC Name | [2-[(5-nitro-1,3-thiazol-2-yl)carbamoyl]phenyl] acetate |  |
| SMILES (canonical) | CC(=O)OC1=CC=CC=C1C(=O)NC2=NC=C(S2)[N+](=O)[O-] | |
| Molecular Formula | C12H9N3O5S | |
| Molecular Weight (g/mol) | 307.28 | |
| InChl | InChI=1S/C12H9N3O5S/c1-7(16)20-9-5-3-2-4-8(9)11(17)14-12-13-6-10(21-12)15(18)19/h2-6H,1H3,(H,13,14,17) | |
| Common Name | Nitazoxanide | |
| Synonyms | Nitaxozanid | Nitaxozanide | Nitazoxanida | Nitazoxanidum | |
| Structural Information | |
 |
|
| Clinical Information | |
|
Category | Antiparasitic products, Insectisides and Repellents
| |
|
Primary Indication (Clinical trial phases) | Approved, Investigational, Vet approved
|  |
| Secondary Indication (Clinical trial phases) | Phase III | |
| Biological Information | |
|
Primary Indication (Disease Category) | Infectious Disease
| |
|
Primary Indication (Disease) | Diarrhea
| |
|
Secondary Indication | Influenza virus (IAV) NA B (Yamagata lineage) |   |
|
Secondary Indication (Approaches) | Experimental | |
| Secondary Indication (Methods) | In-vitro | |
|
Secondary Indication (Potential drug target) | ERp57
| |
|
Secondary Indication (Model system) [cell lines/ animal models] | MDCK-SIAT
| |
|
Secondary Indication (Mode of viral infection) | Adsorption
| |
|
Secondary Indication (Viral titer) | 1000 FFU
| |
|
Secondary Indication (Mode of drug delivery) | Culture
| |
|
Secondary Indication (Time of drug delivery) | After adsorption
| |
|
Secondary Indication (Duration of drug delivery) | 24 hours
| |
|
Secondary Indication (Drug concentration) | 0.6 μM
| |
|
Secondary Indication (Cell based assay) | Focus forming reduction assay
| |
|
Secondary Indication (Change) | Decrease
| |
|
Secondary Indication (Type of Inhibition) | EC50 [ 50 % ] | |
|
Secondary Indication (Cytotoxicity) | 61.2± 15.1 μM | |
|
Reference | Tilmanis D, van Baalen C, Oh DY, Rossignol JF, Hurt AC..The susceptibility of circulating human influenza viruses to tizoxanide, the active metabolite of ni.Antiviral Res. 2017 Nov;147:142-148. doi: 10.1016/j.antiviral.2017.10.002. Epub 2017 Oct 3. PMID:28986103
|  |
|
Comment | Active circulating metabolite of nitazoxanide. This is the first report on the susceptibility of circulating viruses to tizoxanide. The focus reduction assay format described is sensitive, robust, and less laborious than traditional cell based antiviral assays, making it highly suitable for the surveillance of tizoxanide susceptibility in circulating seasonal influenza viruses
| |