| Chemical Information | |
| Antiviral agent ID | DrugRepV_0002 | |
| Antiviral agent name | Chloroquine |  |
| IUPAC Name | 4-N-(7-chloroquinolin-4-yl)-1-N,1-N-diethylpentane-1,4-diamine |  |
| SMILES (canonical) | CCN(CC)CCCC(C)NC1=C2C=CC(=CC2=NC=C1)Cl | |
| Molecular Formula | C18H26ClN3 | |
| Molecular Weight (g/mol) | 319.88 | |
| InChl | InChI=1S/C18H26ClN3/c1-4-22(5-2)12-6-7-14(3)21-17-10-11-20-18-13-15(19)8-9-16(17)18/h8-11,13-14H,4-7,12H2,1-3H3,(H,20,21) | |
| Common Name | Chloroquine | |
| Synonyms | Chloraquine | Chlorochin | Chloroquina | Chloroquine | Chloroquinium | Chloroquinum | Cloroquina | N4-(7-chloro-4-quinolinyl)-N1,N1-diethyl-1,4-pentanediamine | |
| Structural Information | |
 |
|
| Clinical Information | |
|
Category | Antiparasitic products, Insectisides and Repellents
| |
|
Primary Indication (Clinical trial phases) | Approved
|  |
| Biological Information | |
|
Primary Indication (Disease Category) | Infectious Disease
| |
|
Primary Indication (Disease) | Malaria
| |
|
Primary Indication (Drug target/Mode of Action) | Glypican 3 isoform 2
| |
|
Secondary Indication | Zika virus (ZIKV) NA Brazilian strain ZKV2015 |   |
|
Secondary Indication (Approaches) | Experimental | |
| Secondary Indication (Methods) | In-vivo | |
|
Secondary Indication (Potential drug target) | Fusion with endosome
| |
|
Secondary Indication (Model system) [cell lines/ animal models] | AG129
| |
|
Secondary Indication (Mode of viral infection) | Retro-orbital
| |
|
Secondary Indication (Viral titer) | 2000 PFU
| |
|
Secondary Indication (Mode of drug delivery) | Oral
| |
|
Secondary Indication (Time of drug delivery) | Pre infection (2 days)
| |
|
Secondary Indication (Duration of drug delivery) | 15 days
| |
|
Secondary Indication (Drug concentration) | 50 for pre infection and initial phase of 5 days followed by 5 till the experiment mg/kg/day
| |
|
Secondary Indication (Change) | Decrease
| |
|
Secondary Indication (Type of Inhibition) | Percentage Survival [ NA NA ] | |
|
Secondary Indication (Survival rate) | 80 | |
|
Reference | Shiryaev SA, Mesci P, Pinto A, Fernandes I, Sheets N, Shresta S, Farhy C, Huang CT, Strongin AY, Muo.Repurposing of the anti-malaria drug chloroquine for Zika Virus treatment and prophylaxis..Sci Rep. 2017 Nov 17;7(1):15771. doi: 10.1038/s41598-017-15467-6. PMID:29150641
|  |
|
Comment | The CQ attenuated disease severity in ZIKV-infected AG129 mice is being displayed, which is considered the most severe model of ZIKV infection.
| |