| |
---|
Chemical Information |
QSSM_ID: | QSSM_1356
|
SigMol name: | 3-hydroxytridecan-4-one [Link]
|
Abbreviation: | C10-CAI-1 |
IUPAC name: | 3-hydroxytridecan-4-one |
SMILES: | CCCCCCCCCC(=O)[C@@H](O)CC |
Molecular Formula: | C13H26O2 |
Molecular Weight (g/mol): | 214.34 |
Structural Information: | [Link] |
Biological Information |
Name of AHL in article: | C10-CAI-1
|
Synthase gene: | cqsA
|
Recipient gene: | cqsS
|
Organism: | Photobacterium angustum [Link to taxonomy browser] |
Strain: | S14
|
Preliminary assay: | bioluminescence
|
Bacterial strain used in Preliminary assay: | Vibrio harveyi reporter strain WN1397
|
Identification assay: | GC-MS
|
Application: | Bioluminescence and control of gene expression
|
Features of bacteria: | copiotrophic bacterium
|
Reference: | 24372841 [Link to PubMed]
|