| |
|---|
| Chemical Information |
|
QSSM_ID: | QSSM_1339
|
| SigMol name: | 5-(2-phenylethyl)-2-(propan-2-yl)-cyclohexanedione [Link]
|
| Abbreviation: | CHD |
| IUPAC name: | 5-(2-phenylethyl)-2-(propan-2-yl)cyclohexane-1,3-dione |
| SMILES: | CC(C)C1C(=O)CC(CCC2=CC=CC=C2)CC1=O |
| Molecular Formula: | C17H22O2 |
| Molecular Weight (g/mol): | 258.16 |
| Structural Information: | [Link] |
| Biological Information |
|
Name of AHL in article: | 2-phenylethyl cyclohexanediones
|
|
Synthase gene: | darABC
|
|
Recipient gene: | pauR
|
|
Organism: | Photorhabdus asymbiotica [Link to taxonomy browser] |
|
Strain: | PB68.1
|
|
Preliminary assay: | promoter activity analysis
|
|
Bacterial strain used in Preliminary assay: | Photorhabdus asymbiotica containing pBAD-Cherry-pcfA
|
|
Identification assay: | HPLC-MS
|
|
Application: | pathogenicity of bacteria
|
|
Features of bacteria: | insect and human pathogen
|
|
Reference: | 25550519 [Link to PubMed]
|
Copyright © 2015 CSIR-Institute of Microbial Technology, Chandigarh 160036, INDIA.