| |
|---|
| Chemical Information |
|
QSSM_ID: | QSSM_1332
|
| SigMol name: | 4-hydroxy-3-(5-methylhexyl)-6-(2-methylpropyl)-pyranone [Link]
|
| Abbreviation: | alpha-pyrone |
| IUPAC name: | 4-hydroxy-3-(5-methylhexyl)-6-(2-methylpropyl)-2H-pyran-2-one |
| SMILES: | CC(C)CCCCC1=C(O)C=C(CC(C)C)OC1=O |
| Molecular Formula: | C16H26O3 |
| Molecular Weight (g/mol): | 266.19 |
| Structural Information: | [Link] |
| Biological Information |
|
Name of AHL in article: | alpha-pyrone (C7H15)
|
|
Synthase gene: | ppyS
|
|
Recipient gene: | pluR
|
|
Organism: | Photorhabdus temperata [Link to taxonomy browser] |
|
Strain: | TT01
|
|
Preliminary assay: | pyrones bioassay
|
|
Bacterial strain used in Preliminary assay: | Photorhabdus luminescens pcfA-mcherry
|
|
Identification assay: | HPLC-MS
|
|
Application: | group-coordinated behavior
|
|
Features of bacteria: | insect pathogen
|
|
Reference: | 23851573 [Link to PubMed]
|
Copyright © 2015 CSIR-Institute of Microbial Technology, Chandigarh 160036, INDIA.