| |
|---|
| Chemical Information |
|
QSSM_ID: | QSSM_1262
|
| SigMol name: | 2-heptylquinolin-4(1H)-one [Link]
|
| Abbreviation: | HHQ |
| IUPAC name: | 2-heptyl-1H-quinolin-4-one |
| SMILES: | CCCCCCCC1=CC(=O)C2=CC=CC=C2N1 |
| Molecular Formula: | C16H21NO |
| Molecular Weight (g/mol): | 243.34 |
| Structural Information: | [Link] |
| Biological Information |
|
Name of AHL in article: | 2-heptyl-4-quinolone
|
|
Synthase gene: | pqsH
|
|
Recipient gene: | pqsR
|
|
Organism: | Pseudomonas aeruginosa [Link to taxonomy browser] |
|
Strain: | PA14
|
|
Preliminary assay: | PQS bioassay
|
|
Bacterial strain used in Preliminary assay: | Pseudomonas aeruginosa strain PAO-R1
|
|
Identification assay: | Not Specified
|
|
Application: | induces the production of the phenazine-1-carboxylic acid (PCA)
|
|
Features of bacteria: | opportunistic pathogen
|
|
Reference: | 21965567 [Link to PubMed]
|
Copyright © 2015 CSIR-Institute of Microbial Technology, Chandigarh 160036, INDIA.