| |
---|
Chemical Information |
QSSM_ID: | QSSM_1221
|
SigMol name: | 2-heptyl-3-hydroxy-4(1H)-quinolone [Link]
|
Abbreviation: | PQS |
IUPAC name: | 2-heptyl-3-hydroxy-1H-quinolin-4-one |
SMILES: | CCCCCCCC1=C(C(=O)C2=CC=CC=C2N1)O |
Molecular Formula: | C16H21NO2 |
Molecular Weight (g/mol): | 259.34 |
Structural Information: | [Link] |
Biological Information |
Name of AHL in article: | 2-heptyl-3-hydroxy-4-quinolone
|
Synthase gene: | pqsH
|
Recipient gene: | pqsR
|
Organism: | Pseudomonas aeruginosa [Link to taxonomy browser] |
Strain: | PA10
|
Preliminary assay: | PQS bioassay
|
Bacterial strain used in Preliminary assay: | Pseudomonas aeruginosa strain PAO-R1
|
Identification assay: | HP-TLC
|
Application: | expression of virulence genes and biofilm formation
|
Features of bacteria: | opportunistic pathogen
|
Reference: | 23727863 [Link to PubMed]
|