| |
|---|
| Chemical Information |
|
QSSM_ID: | QSSM_1158
|
| SigMol name: | cyclo(L-Leu-L-Phe) [Link]
|
| Abbreviation: | cyclo-LF |
| IUPAC name: | (3S,6Z)-3-Benzyl-6-(2-methylpropylidene)-2,5-piperazinedione |
| SMILES: | O=C1C(=C/C(C)C)/NC(=O)[C@@H](N1)Cc2ccccc2 |
| Molecular Formula: | C15H18N2O2 |
| Molecular Weight (g/mol): | 258.14 |
| Structural Information: | [Link] |
| Biological Information |
|
Name of AHL in article: | cyclo(L-Leu-L-Phe)
|
|
Synthase gene: | Not Specified
|
|
Recipient gene: | Not Specified
|
|
Organism: | Streptomyces albulus [Link to taxonomy browser] |
|
Strain: | KO-23
|
|
Preliminary assay: | DKP bioassay
|
|
Bacterial strain used in Preliminary assay: | Agrobacterium tumefaciens NT1(pDCI41E33) Chromobacterium violaceum CV026
|
|
Identification assay: | NMR
|
|
Application: | Not Specified
|
|
Features of bacteria: | Filamentous gram positive bacteria
|
|
Reference: | 11213286 [Link to PubMed]
|
Copyright © 2015 CSIR-Institute of Microbial Technology, Chandigarh 160036, INDIA.