| |
|---|
| Chemical Information |
|
QSSM_ID: | QSSM_1115
|
| SigMol name: | cyclo(L-Ala-L-Val) [Link]
|
| Abbreviation: | cyclo-AV |
| IUPAC name: | 3-(propan-2-yl)-6-(propan-2-ylidene)piperazine-2,5-dione |
| SMILES: | CC(C)C1NC(=O)C(NC1=O)=C(C)C |
| Molecular Formula: | C10H16N2O2 |
| Molecular Weight (g/mol): | 196.12 |
| Structural Information: | [Link] |
| Biological Information |
|
Name of AHL in article: | cyclo(L-Ala-L-Val)
|
|
Synthase gene: | Not Specified
|
|
Recipient gene: | Not Specified
|
|
Organism: | Pseudomonas aeruginosa [Link to taxonomy browser] |
|
Strain: | PA01
|
|
Preliminary assay: | DKP bioassay
|
|
Bacterial strain used in Preliminary assay: | Escherichia coli JM109 (pSB401)
|
|
Identification assay: | MS-NMR
|
|
Application: | activating or antagonizing lux-based AHL biosensors and AHL-dependent swarming in Serratia liquefaciens.
|
|
Features of bacteria: | opportunistic human pathogen
|
|
Reference: | 10510239 [Link to PubMed]
|
Copyright © 2015 CSIR-Institute of Microbial Technology, Chandigarh 160036, INDIA.