| |
|---|
| Chemical Information |
|
QSSM_ID: | QSSM_1113
|
| SigMol name: | cyclo(L-Phe-L-Pro) [Link]
|
| Abbreviation: | cyclo-FP |
| IUPAC name: | 3-Benzylhexahydropyrrolo[1,2-a]pyrazine-1,4-dione |
| SMILES: | c1ccc(cc1)CC2C(=O)N3CCCC3C(=O)N2 |
| Molecular Formula: | C14H16N2O2 |
| Molecular Weight (g/mol): | 244.12 |
| Structural Information: | [Link] |
| Biological Information |
|
Name of AHL in article: | cyclo(L-Phe-L-Pro)
|
|
Synthase gene: | Not Specified
|
|
Recipient gene: | Not Specified
|
|
Organism: | Pseudomonas putida [Link to taxonomy browser] |
|
Strain: | WCS358
|
|
Preliminary assay: | DKP bioassay
|
|
Bacterial strain used in Preliminary assay: | Agrobacterium tumefaciens NT1 (pDCI4E33), Chromobacterium violaceum CV026
|
|
Identification assay: | HPLC
|
|
Application: | role in stimulating and antagonizing AHL bacterial sensors
|
|
Features of bacteria: | rhizosphere-colonizing plant growth-promoting organism
|
|
Reference: | 12192521 [Link to PubMed]
|
Copyright © 2015 CSIR-Institute of Microbial Technology, Chandigarh 160036, INDIA.