| |
---|
Chemical Information |
QSSM_ID: | QSSM_0981
|
SigMol name: | N-(3-Hydroxydodecanoyl)-L-homoserine lactone [Link]
|
Abbreviation: | OHC12-HSL |
IUPAC name: | 3-Hydroxy-N-(2-oxotetrahydro-3-furanyl)dodecanamide |
SMILES: | CCCCCCCCCC(CC(=O)N[C@H]1CCOC1=O)O |
Molecular Formula: | C16H29NO4 |
Molecular Weight (g/mol): | 299.41 |
Structural Information: | [Link] |
Biological Information |
Name of AHL in article: | N-(3-hydroxy-dodecanoyl)-L-homoserine lactone
|
Synthase gene: | anoI
|
Recipient gene: | anoR
|
Organism: | Acinetobacter nosocomialis [Link to taxonomy browser] |
Strain: | ATCC 17903
|
Preliminary assay: | AHL bioassay
|
Bacterial strain used in Preliminary assay: | Agrobacterium tumefaciens NT1 (pDCI41E33)
|
Identification assay: | LC-MS
|
Application: | Biofilm formation
|
Features of bacteria: | nosocomial pathogen
|
Reference: | 25975610 [Link to PubMed]
|