| |
---|
Chemical Information |
QSSM_ID: | QSSM_0885
|
SigMol name: | N-Decenoyl-L-homoserine lactone [Link]
|
Abbreviation: | C10:1-HSL |
IUPAC name: | N-(2-oxooxolan-3-yl)dec-9-enamide |
SMILES: | C=CCCCCCCCC(=O)NC1CCOC1=O |
Molecular Formula: | C14H23NO3 |
Molecular Weight (g/mol): | 253.17 |
Structural Information: | [Link] |
Biological Information |
Name of AHL in article: | monounsaturated acyl-HSL
|
Synthase gene: | nwiI
|
Recipient gene: | nwiR
|
Organism: | Nitrobacter winogradskyi [Link to taxonomy browser] |
Strain: | Nb-255
|
Preliminary assay: | AHL bioassay
|
Bacterial strain used in Preliminary assay: | Agrobacterium tumefaciens KYC55 (pJZ372)(pJZ384)(pJZ410)
|
Identification assay: | UPLC-IDA-MS
|
Application: | Nitrogen metabolism and biofilm formation
|
Features of bacteria: | chemolithotrophic bacterium
|
Reference: | 26092466 [Link to PubMed]
|