| |
|---|
| Chemical Information |
|
QSSM_ID: | QSSM_0876
|
| SigMol name: | N-(3-Oxooctanoyl)-L-homoserine lactone [Link]
|
| Abbreviation: | OC8-HSL |
| IUPAC name: | 3-oxo-N-[(3S)-2-oxooxolan-3-yl]octanamide |
| SMILES: | CCCCCC(=O)CC(=O)NC1CCOC1=O |
| Molecular Formula: | C12H19NO4 |
| Molecular Weight (g/mol): | 241.28 |
| Structural Information: | [Link] |
| Biological Information |
|
Name of AHL in article: | 3-oxo-C8-HSL
|
|
Synthase gene: | luxI homologue
|
|
Recipient gene: | luxR homologue
|
|
Organism: | Enterobacter sakazakii [Link to taxonomy browser] |
|
Strain: | 1159/04
|
|
Preliminary assay: | AHL bioassay
|
|
Bacterial strain used in Preliminary assay: | Escherichia coli pSB403
|
|
Identification assay: | TLC
|
|
Application: | biofilm formation, production of cellulose, production of extracellular polysaccharide
|
|
Features of bacteria: | opportunistic pathogen
|
|
Reference: | 16300064 [Link to PubMed]
|
Copyright © 2015 CSIR-Institute of Microbial Technology, Chandigarh 160036, INDIA.