| |
---|
Chemical Information |
QSSM_ID: | QSSM_0862
|
SigMol name: | N-(3-Oxooctanoyl)-L-homoserine lactone [Link]
|
Abbreviation: | OC8-HSL |
IUPAC name: | 3-oxo-N-[(3S)-2-oxooxolan-3-yl]octanamide |
SMILES: | CCCCCC(=O)CC(=O)NC1CCOC1=O |
Molecular Formula: | C12H19NO4 |
Molecular Weight (g/mol): | 241.28 |
Structural Information: | [Link] |
Biological Information |
Name of AHL in article: | 3-oxo-C8-HSL
|
Synthase gene: | luxI homologue
|
Recipient gene: | luxR homologue
|
Organism: | Enterobacter sakazakii [Link to taxonomy browser] |
Strain: | FSM271
|
Preliminary assay: | AHL bioassay
|
Bacterial strain used in Preliminary assay: | Escherichia coli pSB403
|
Identification assay: | TLC
|
Application: | biofilm formation, production of cellulose, production of extracellular polysaccharide
|
Features of bacteria: | opportunistic pathogen
|
Reference: | 16300064 [Link to PubMed]
|