| |
---|
Chemical Information |
QSSM_ID: | QSSM_0806
|
SigMol name: | N-(3-Oxooctanoyl)-L-homoserine lactone [Link]
|
Abbreviation: | OC8-HSL |
IUPAC name: | 3-oxo-N-[(3S)-2-oxooxolan-3-yl]octanamide |
SMILES: | CCCCCC(=O)CC(=O)NC1CCOC1=O |
Molecular Formula: | C12H19NO4 |
Molecular Weight (g/mol): | 241.28 |
Structural Information: | [Link] |
Biological Information |
Name of AHL in article: | 3-oxo-octanoylhomoserine lactone
|
Synthase gene: | expI
|
Recipient gene: | expR
|
Organism: | Erwinia carotovora [Link to taxonomy browser] |
Strain: | SCC3193
|
Preliminary assay: | AHL bioassay
|
Bacterial strain used in Preliminary assay: | Not Specified
|
Identification assay: | LC-MS
|
Application: | production of plant cell-wall
degrading enzymes (PCWDE) and virulence
|
Features of bacteria: | soft rot bacteria
|
Reference: | 16796682 [Link to PubMed]
|