| |
|---|
| Chemical Information |
|
QSSM_ID: | QSSM_0785
|
| SigMol name: | N-(3-Oxododecanoyl)-L-homoserine lactone [Link]
|
| Abbreviation: | OC12-HSL |
| IUPAC name: | 3-oxo-N-(2-oxooxolan-3-yl)dodecanamide |
| SMILES: | CCCCCCCCCC(=O)CC(=O)NC1CCOC1=O |
| Molecular Formula: | C16H27NO4 |
| Molecular Weight (g/mol): | 297.39 |
| Structural Information: | [Link] |
| Biological Information |
|
Name of AHL in article: | N-(3-oxododecanoyl)homoserine lactone
|
|
Synthase gene: | yenI
|
|
Recipient gene: | yenR
|
|
Organism: | Yersinia enterocolitica [Link to taxonomy browser] |
|
Strain: | 90/54
|
|
Preliminary assay: | AHL bioassay
|
|
Bacterial strain used in Preliminary assay: | Chromobacterium violaceum CV026 and Escherichia coli JM109 lasRI'::luxCDABE (pSB1075)
|
|
Identification assay: | LC-MS
|
|
Application: | controls swimming motility, swarming motility and temporally controls flagellar synthesis
|
|
Features of bacteria: | mammalian enteropathogen
|
|
Reference: | 16452428 [Link to PubMed]
|
Copyright © 2015 CSIR-Institute of Microbial Technology, Chandigarh 160036, INDIA.