| |
---|
Chemical Information |
QSSM_ID: | QSSM_0780
|
SigMol name: | N-(3-Oxododecanoyl)-L-homoserine lactone [Link]
|
Abbreviation: | OC12-HSL |
IUPAC name: | 3-oxo-N-(2-oxooxolan-3-yl)dodecanamide |
SMILES: | CCCCCCCCCC(=O)CC(=O)NC1CCOC1=O |
Molecular Formula: | C16H27NO4 |
Molecular Weight (g/mol): | 297.39 |
Structural Information: | [Link] |
Biological Information |
Name of AHL in article: | 3-oxo-C12-HSL
|
Synthase gene: | GDI2836
|
Recipient gene: | GDI2838
|
Organism: | Gluconacetobacter diazotrophicus [Link to taxonomy browser] |
Strain: | PAL5
|
Preliminary assay: | AHL bioassay
|
Bacterial strain used in Preliminary assay: | Agrobacterium tumefaciens NTL4 (pCF218 pCF372), Pseudomonas putida F117 (pKR- C12) (pAS- C8)
|
Identification assay: | LC-APCI-MS
|
Application: | regulation of the microbial interactions with the environment
|
Features of bacteria: | diazotrophic bacteria
|
Reference: | 22350020 [Link to PubMed]
|